| Ingredient Name | (2R)-2-[(3S,5S,9S,10S,13R,14R,17R)-3-Hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enoic acid |
| Pubchem CID | 154831692 |
| Iupac name | (2R)-2-[(3S,5S,9S,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enoic acid |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.7 |
| Isomeric smiles | CC(=CCC[C@H]([C@H]1CC[C@@]2([C@@]1(CC[C@@H]3C2=CC[C@H]4[C@]3(CC[C@@H](C4(C)C)O)C)C)C)C(=O)O)C |
| InChI | InChI=1S/C30H48O3/c1-19(2)9-8-10-20(26(32)33)21-13-17-30(7)23-11-12-24-27(3,4)25(31)15-16-28(24,5)22(23)14-18-29(21,30)6/h9,11,20-22,24-25,31H,8,10,12-18H2,1-7H3,(H,32,33)/t20-,21-,22-,24-,25+,28+,29-,30+/m1/s1 |
| InChIKey | CGPBVNAIDFBRJG-IAQQMPTMSA-N |
| External Database Links |
| nHA(Number of hydrogen bond acceptors) | 3 |
| nHD(Number of hydrogen bond donors) | 2 |
| nRot(Number of rotatable bonds) | 5 |
| nRing(Number of rings) | 4 |
| MaxRing(Number of atoms in the biggest ring) | 17 |
| nHet(Number of heteroatoms) | 3 |
| nRig(Number of rigid bonds) | 22 |
| Flexibility | 0.227 |
| Stereo Centers(Number of stereocenters) | 8 |
| TPSA(Topological polar surface area) | 57.53 |
| logS(The logarithm of aqueous solubility value) | -4.862 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 7.223 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 5.082 |
| Quantitative Estimate of Drug-likeness | 0.424 |
| Synthetic accessibility score | 4.717 |
| Natural Product-likeness score | 3.517 |
| Lipinski Rule | Accepted |
| GSK Rule | Rejected |
| Golden Triangle | Rejected |
| Caco-2 Permeability | -5.006 |
| MDCK Permeability | 1.44E-05 |
| Pgp-substrate | 0.001 |
| HIA(human intestinal absorption) | 0.009 |
| F20%(20% Oral Bioavailability) | 0.944 |
| F30%(30% Oral Bioavailability) | 0.32 |
| PPB(Plasma protein binding) | 93.74% |
| VD(Volume Distribution) | 0.728 |
| BBB Penetration(Blood brain barrier penetration) | 0.269 |
| B3 Penetration(Blood brain barrier penetration) | Non-Permeable |
| Fu(The fraction unbound in plasms) | 3.13% |
| CYP1A2 inhibitor | 0.02 |
| CYP1A2 substrate | 0.142 |
| CYP2C19 inhibitor | 0.027 |
| CYP2C19 substrate | 0.866 |
| CYP2C9 inhibitor | 0.203 |
| CYP2C9 substrate | 0.915 |
| CYP2D6 inhibitor | 0.004 |
| CYP2D6 substrate | 0.254 |
| CYP3A4 inhibitor | 0.103 |
| CYP3A4 substrate | 0.123 |
| CL(The clearance of a drug) | 4.619 |
| T1/2 | 0.071 |
| NonBiodegradable Rule | 0 |
| Pfizer Rule | Rejected |
| SR-MMP | 0.893 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.944 |
| IGC50 | 4.424 |
| LC50FM | 6.032 |
| LC50DM | 6.458 |
| NR-AR(Androgen receptor) | 0.933 |
| NR-AR-LBD(Androgen receptor) | 0.86 |
| NR-Aromatase | 0.185 |
| NR-ER(Estrogen receptor) | 0.294 |
| NR-ER-LBD(Estrogen receptor) | 0.233 |
| Skin Sensitization Rule | 0 |
| Skin Sensitization | 0.778 |
| Acute Toxicity Rule | 1 |
| Rat Oral Acute Toxicity | 0.68 |
| hERG Blockers | 0.05 |
| H-HT(The human hepatotoxicity) | 0.643 |
| DILI(Drug-induced liver injury) | 0.011 |
| Eye Corrosion | 0.233 |
| Eye Irritation | 0.198 |
| Respiratory Toxicity | 0.956 |
| AMES Toxicity | 0.003 |
| Carcinogencity | 0.305 |
| SR-ARE(Antioxidant Response Element) | 0.527 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.043 |
| SR-p53 | 0.405 |