| Ingredient Name | (1S,2R,3R,4R,5R,6S,7S,8R,9R,13R,14R,16S,17R,18R)-11-ethyl-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,5,7,8,14-pentol |
| Pubchem CID | 131674266 |
| Iupac name | (1S,2R,3R,4R,5R,6S,7S,8R,9R,13R,14R,16S,17R,18R)-11-ethyl-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,5,7,8,14-pentol |
| Molecular Formula | C25H41NO9 |
| Molecular Weight | 499.6 |
| Isomeric smiles | CCN1C[C@@]2([C@@H](C[C@@H]([C@@]34[C@H]2[C@H]([C@@H](C31)[C@@]5([C@@H]6[C@H]4C[C@@]([C@@H]6O)([C@H]([C@@H]5O)OC)O)O)OC)OC)O)COC |
| InChI | InChI=1S/C25H41NO9/c1-6-26-9-22(10-32-2)12(27)7-13(33-3)24-11-8-23(30)19(28)14(11)25(31,20(29)21(23)35-5)15(18(24)26)16(34-4)17(22)24/h11-21,27-31H,6-10H2,1-5H3/t11-,12-,13+,14-,15+,16+,17+,18?,19-,20+,21+,22+,23-,24+,25-/m1/s1 |
| InChIKey | SQMGCPHFHQGPIF-BNJQLZKQSA-N |
| External Database Links |
| nHA(Number of hydrogen bond acceptors) | 10 |
| nHD(Number of hydrogen bond donors) | 5 |
| nRot(Number of rotatable bonds) | 6 |
| nRing(Number of rings) | 6 |
| MaxRing(Number of atoms in the biggest ring) | 0 |
| nHet(Number of heteroatoms) | 10 |
| nRig(Number of rigid bonds) | 24 |
| Flexibility | 0.25 |
| Stereo Centers(Number of stereocenters) | 15 |
| TPSA(Topological polar surface area) | 141.31 |
| logS(The logarithm of aqueous solubility value) | -3.252 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 0.338 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | -0.207 |
| Quantitative Estimate of Drug-likeness | 0.285 |
| Synthetic accessibility score | 7.476 |
| Natural Product-likeness score | 3.313 |
| Lipinski Rule | Accepted |
| GSK Rule | Rejected |
| Golden Triangle | Accepted |
| Caco-2 Permeability | -5.711 |
| MDCK Permeability | 6.41E-05 |
| Pgp-substrate | 0.994 |
| HIA(human intestinal absorption) | 0.829 |
| F20%(20% Oral Bioavailability) | 0.422 |
| F30%(30% Oral Bioavailability) | 0.965 |
| PPB(Plasma protein binding) | 16.61% |
| VD(Volume Distribution) | 0.471 |
| BBB Penetration(Blood brain barrier penetration) | 0.073 |
| B3 Penetration(Blood brain barrier penetration) | Non-Permeable |
| Fu(The fraction unbound in plasms) | 65.97% |
| CYP1A2 inhibitor | 0.001 |
| CYP1A2 substrate | 0.964 |
| CYP2C19 inhibitor | 0.002 |
| CYP2C19 substrate | 0.631 |
| CYP2C9 inhibitor | 0 |
| CYP2C9 substrate | 0.011 |
| CYP2D6 inhibitor | 0.001 |
| CYP2D6 substrate | 0.204 |
| CYP3A4 inhibitor | 0.014 |
| CYP3A4 substrate | 0.091 |
| CL(The clearance of a drug) | 1.66 |
| T1/2 | 0.665 |
| NonBiodegradable Rule | 1 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.299 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.206 |
| IGC50 | 2.839 |
| LC50FM | 3.556 |
| LC50DM | 8.321 |
| NR-AR(Androgen receptor) | 0.13 |
| NR-AR-LBD(Androgen receptor) | 0.014 |
| NR-Aromatase | 0.066 |
| NR-ER(Estrogen receptor) | 0.134 |
| NR-ER-LBD(Estrogen receptor) | 0.244 |
| Skin Sensitization Rule | 0 |
| Skin Sensitization | 0.457 |
| Acute Toxicity Rule | 0 |
| Rat Oral Acute Toxicity | 0.661 |
| hERG Blockers | 0.505 |
| H-HT(The human hepatotoxicity) | 0.72 |
| DILI(Drug-induced liver injury) | 0.092 |
| Eye Corrosion | 0.003 |
| Eye Irritation | 0.007 |
| Respiratory Toxicity | 0.953 |
| AMES Toxicity | 0.189 |
| Carcinogencity | 0.004 |
| SR-ARE(Antioxidant Response Element) | 0.037 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.862 |
| SR-p53 | 0.673 |