| Ingredient Name | (1S,4Z,12S,13R)-5,10-dimethyl-8,14,16-trioxatetracyclo[10.2.2.01,13.07,11]hexadeca-4,7(11),9-trien-15-one |
| Pubchem CID | 127258921 |
| Iupac name | (1S,4Z,12S,13R)-5,10-dimethyl-8,14,16-trioxatetracyclo[10.2.2.01,13.07,11]hexadeca-4,7(11),9-trien-15-one |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.28 |
| Isomeric smiles | C/C/1=C/CC[C@@]23[C@H](O2)[C@H](C4=C(C1)OC=C4C)OC3=O |
| InChI | InChI=1S/C15H16O4/c1-8-4-3-5-15-13(19-15)12(18-14(15)16)11-9(2)7-17-10(11)6-8/h4,7,12-13H,3,5-6H2,1-2H3/b8-4-/t12-,13+,15-/m0/s1 |
| InChIKey | KBMSVODXFLAQNJ-ILKNJTSDSA-N |
| External Database Links |
| nHA(Number of hydrogen bond acceptors) | 4 |
| nHD(Number of hydrogen bond donors) | 0 |
| nRot(Number of rotatable bonds) | 0 |
| nRing(Number of rings) | 4 |
| MaxRing(Number of atoms in the biggest ring) | 14 |
| nHet(Number of heteroatoms) | 4 |
| nRig(Number of rigid bonds) | 20 |
| Flexibility | 0 |
| Stereo Centers(Number of stereocenters) | 3 |
| TPSA(Topological polar surface area) | 51.97 |
| logS(The logarithm of aqueous solubility value) | -4.154 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 2.53 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 2.695 |
| Quantitative Estimate of Drug-likeness | 0.409 |
| Synthetic accessibility score | 5.798 |
| Natural Product-likeness score | 3.448 |
| Lipinski Rule | Accepted |
| GSK Rule | Accepted |
| Golden Triangle | Accepted |
| Caco-2 Permeability | -4.674 |
| MDCK Permeability | 1.82E-05 |
| Pgp-substrate | 0.09 |
| HIA(human intestinal absorption) | 0.016 |
| F20%(20% Oral Bioavailability) | 0.01 |
| F30%(30% Oral Bioavailability) | 0.425 |
| PPB(Plasma protein binding) | 89.64% |
| VD(Volume Distribution) | 2.835 |
| BBB Penetration(Blood brain barrier penetration) | 0.61 |
| B3 Penetration(Blood brain barrier penetration) | Permeable |
| Fu(The fraction unbound in plasms) | 7.35% |
| CYP1A2 inhibitor | 0.059 |
| CYP1A2 substrate | 0.746 |
| CYP2C19 inhibitor | 0.553 |
| CYP2C19 substrate | 0.764 |
| CYP2C9 inhibitor | 0.162 |
| CYP2C9 substrate | 0.085 |
| CYP2D6 inhibitor | 0.024 |
| CYP2D6 substrate | 0.725 |
| CYP3A4 inhibitor | 0.62 |
| CYP3A4 substrate | 0.421 |
| CL(The clearance of a drug) | 14.826 |
| T1/2 | 0.552 |
| NonBiodegradable Rule | 2 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.337 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.036 |
| IGC50 | 4.736 |
| LC50FM | 6.251 |
| LC50DM | 6.724 |
| NR-AR(Androgen receptor) | 0.009 |
| NR-AR-LBD(Androgen receptor) | 0.368 |
| NR-Aromatase | 0.77 |
| NR-ER(Estrogen receptor) | 0.534 |
| NR-ER-LBD(Estrogen receptor) | 0.494 |
| Skin Sensitization Rule | 4 |
| Skin Sensitization | 0.592 |
| Acute Toxicity Rule | 4 |
| Rat Oral Acute Toxicity | 0.888 |
| hERG Blockers | 0.034 |
| H-HT(The human hepatotoxicity) | 0.757 |
| DILI(Drug-induced liver injury) | 0.826 |
| Eye Corrosion | 0.016 |
| Eye Irritation | 0.025 |
| Respiratory Toxicity | 0.959 |
| AMES Toxicity | 0.636 |
| Carcinogencity | 0.86 |
| SR-ARE(Antioxidant Response Element) | 0.589 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.118 |
| SR-p53 | 0.941 |