| Ingredient Name | (2R,3R,4R,5R,6S,7S,8R,13S,14R,16S,18R)-11-ethyl-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,5,7,8,14-pentol |
| Pubchem CID | 122173269 |
| Iupac name | (2R,3R,4R,5R,6S,7S,8R,13S,14R,16S,18R)-11-ethyl-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,5,7,8,14-pentol |
| Molecular Formula | C25H41NO9 |
| Molecular Weight | 499.6 |
| Isomeric smiles | CCN1C[C@]2([C@@H](C[C@@H](C34C2[C@H](C(C31)[C@@]5([C@@H]6[C@H]4C[C@@]([C@@H]6O)([C@H]([C@@H]5O)OC)O)O)OC)OC)O)COC |
| InChI | InChI=1S/C25H41NO9/c1-6-26-9-22(10-32-2)12(27)7-13(33-3)24-11-8-23(30)19(28)14(11)25(31,20(29)21(23)35-5)15(18(24)26)16(34-4)17(22)24/h11-21,27-31H,6-10H2,1-5H3/t11-,12-,13+,14-,15?,16+,17?,18?,19-,20+,21+,22-,23-,24?,25-/m1/s1 |
| InChIKey | SQMGCPHFHQGPIF-JPTXIPOMSA-N |
| External Database Links |
| nHA(Number of hydrogen bond acceptors) | 10 |
| nHD(Number of hydrogen bond donors) | 5 |
| nRot(Number of rotatable bonds) | 6 |
| nRing(Number of rings) | 6 |
| MaxRing(Number of atoms in the biggest ring) | 0 |
| nHet(Number of heteroatoms) | 10 |
| nRig(Number of rigid bonds) | 24 |
| Flexibility | 0.25 |
| Stereo Centers(Number of stereocenters) | 15 |
| TPSA(Topological polar surface area) | 141.31 |
| logS(The logarithm of aqueous solubility value) | -3.619 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 0.19 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | -0.067 |
| Quantitative Estimate of Drug-likeness | 0.285 |
| Synthetic accessibility score | 7.476 |
| Natural Product-likeness score | 3.313 |
| Lipinski Rule | Accepted |
| GSK Rule | Rejected |
| Golden Triangle | Accepted |
| Caco-2 Permeability | -5.835 |
| MDCK Permeability | 8.50E-05 |
| Pgp-substrate | 0.995 |
| HIA(human intestinal absorption) | 0.884 |
| F20%(20% Oral Bioavailability) | 0.093 |
| F30%(30% Oral Bioavailability) | 0.93 |
| PPB(Plasma protein binding) | 19.29% |
| VD(Volume Distribution) | 0.458 |
| BBB Penetration(Blood brain barrier penetration) | 0.069 |
| B3 Penetration(Blood brain barrier penetration) | Non-Permeable |
| Fu(The fraction unbound in plasms) | 63.95% |
| CYP1A2 inhibitor | 0.001 |
| CYP1A2 substrate | 0.953 |
| CYP2C19 inhibitor | 0.001 |
| CYP2C19 substrate | 0.686 |
| CYP2C9 inhibitor | 0 |
| CYP2C9 substrate | 0.012 |
| CYP2D6 inhibitor | 0.001 |
| CYP2D6 substrate | 0.216 |
| CYP3A4 inhibitor | 0.01 |
| CYP3A4 substrate | 0.08 |
| CL(The clearance of a drug) | 1.868 |
| T1/2 | 0.445 |
| NonBiodegradable Rule | 1 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.252 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.231 |
| IGC50 | 2.41 |
| LC50FM | 2.625 |
| LC50DM | 7.724 |
| NR-AR(Androgen receptor) | 0.04 |
| NR-AR-LBD(Androgen receptor) | 0.033 |
| NR-Aromatase | 0.042 |
| NR-ER(Estrogen receptor) | 0.123 |
| NR-ER-LBD(Estrogen receptor) | 0.241 |
| Skin Sensitization Rule | 0 |
| Skin Sensitization | 0.44 |
| Acute Toxicity Rule | 0 |
| Rat Oral Acute Toxicity | 0.457 |
| hERG Blockers | 0.356 |
| H-HT(The human hepatotoxicity) | 0.407 |
| DILI(Drug-induced liver injury) | 0.019 |
| Eye Corrosion | 0.003 |
| Eye Irritation | 0.005 |
| Respiratory Toxicity | 0.976 |
| AMES Toxicity | 0.104 |
| Carcinogencity | 0.01 |
| SR-ARE(Antioxidant Response Element) | 0.023 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.637 |
| SR-p53 | 0.551 |