| Ingredient Name | [(1S,2R,3R,4R,5R,6S,7S,8R,9R,10R,13R,14R,16S,17S,18R)-5,7,14-trihydroxy-6,8,16,18-tetramethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate |
| Pubchem CID | 102375480 |
| Iupac name | [(1S,2R,3R,4R,5R,6S,7S,8R,9R,10R,13R,14R,16S,17S,18R)-5,7,14-trihydroxy-6,8,16,18-tetramethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate |
| Molecular Formula | C32H45NO10 |
| Molecular Weight | 603.7 |
| Isomeric smiles | CN1C[C@@]2([C@@H](C[C@@H]([C@@]34[C@@H]2[C@H]([C@@H]([C@H]31)[C@@]5([C@@H]6[C@H]4C[C@@]([C@@H]6OC(=O)C7=CC=CC=C7)([C@H]([C@@H]5O)OC)O)OC)OC)OC)O)COC |
| InChI | InChI=1S/C32H45NO10/c1-33-14-29(15-38-2)18(34)12-19(39-3)31-17-13-30(37)26(43-28(36)16-10-8-7-9-11-16)20(17)32(42-6,25(35)27(30)41-5)21(24(31)33)22(40-4)23(29)31/h7-11,17-27,34-35,37H,12-15H2,1-6H3/t17-,18-,19+,20-,21+,22+,23-,24-,25+,26-,27+,29+,30-,31+,32-/m1/s1 |
| InChIKey | GPKLKIFNFCDMHE-BMTFSNIDSA-N |
| External Database Links | HERB2.0: HBIN029452 |
| nHA(Number of hydrogen bond acceptors) | 11 |
| nHD(Number of hydrogen bond donors) | 3 |
| nRot(Number of rotatable bonds) | 9 |
| nRing(Number of rings) | 7 |
| MaxRing(Number of atoms in the biggest ring) | 6 |
| nHet(Number of heteroatoms) | 11 |
| nRig(Number of rigid bonds) | 31 |
| Flexibility | 0.29 |
| Stereo Centers(Number of stereocenters) | 15 |
| TPSA(Topological polar surface area) | 136.38 |
| logS(The logarithm of aqueous solubility value) | -3.696 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 1.251 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 1.627 |
| Quantitative Estimate of Drug-likeness | 0.355 |
| Synthetic accessibility score | 7.265 |
| Natural Product-likeness score | 3.078 |
| Lipinski Rule | Rejected |
| GSK Rule | Rejected |
| Golden Triangle | Rejected |
| Caco-2 Permeability | -5.411 |
| MDCK Permeability | 6.94E-05 |
| Pgp-substrate | 0.991 |
| HIA(human intestinal absorption) | 0.748 |
| F20%(20% Oral Bioavailability) | 0.278 |
| F30%(30% Oral Bioavailability) | 0.743 |
| PPB(Plasma protein binding) | 23.02% |
| VD(Volume Distribution) | 0.751 |
| BBB Penetration(Blood brain barrier penetration) | 0.085 |
| B3 Penetration(Blood brain barrier penetration) | Non-Permeable |
| Fu(The fraction unbound in plasms) | 53.58% |
| CYP1A2 inhibitor | 0.008 |
| CYP1A2 substrate | 0.962 |
| CYP2C19 inhibitor | 0.003 |
| CYP2C19 substrate | 0.762 |
| CYP2C9 inhibitor | 0.002 |
| CYP2C9 substrate | 0.011 |
| CYP2D6 inhibitor | 0.01 |
| CYP2D6 substrate | 0.322 |
| CYP3A4 inhibitor | 0.138 |
| CYP3A4 substrate | 0.53 |
| CL(The clearance of a drug) | 4.136 |
| T1/2 | 0.602 |
| NonBiodegradable Rule | 1 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.435 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.19 |
| IGC50 | 3.603 |
| LC50FM | 4.953 |
| LC50DM | 8.203 |
| NR-AR(Androgen receptor) | 0.084 |
| NR-AR-LBD(Androgen receptor) | 0.072 |
| NR-Aromatase | 0.211 |
| NR-ER(Estrogen receptor) | 0.098 |
| NR-ER-LBD(Estrogen receptor) | 0.115 |
| Skin Sensitization Rule | 0 |
| Skin Sensitization | 0.151 |
| Acute Toxicity Rule | 0 |
| Rat Oral Acute Toxicity | 0.627 |
| hERG Blockers | 0.769 |
| H-HT(The human hepatotoxicity) | 0.891 |
| DILI(Drug-induced liver injury) | 0.35 |
| Eye Corrosion | 0.003 |
| Eye Irritation | 0.008 |
| Respiratory Toxicity | 0.944 |
| AMES Toxicity | 0.029 |
| Carcinogencity | 0.006 |
| SR-ARE(Antioxidant Response Element) | 0.041 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.455 |
| SR-p53 | 0.76 |