| Ingredient Name | (1R,6R,7S,8S,9R,10S,11S,13S,16S,17R)-8-tert-butyl-6,9,17-trihydroxy-16-methyl-2,4,14,19-tetraoxahexacyclo[8.7.2.01,11.03,7.07,11.013,17]nonadecane-5,15,18-trione |
| Pubchem CID | 102004438 |
| Iupac name | (1R,6R,7S,8S,9R,10S,11S,13S,16S,17R)-8-tert-butyl-6,9,17-trihydroxy-16-methyl-2,4,14,19-tetraoxahexacyclo[8.7.2.01,11.03,7.07,11.013,17]nonadecane-5,15,18-trione |
| Molecular Formula | C20H24O10 |
| Molecular Weight | 424.4 |
| Isomeric smiles | C[C@@H]1C(=O)O[C@@H]2[C@]1([C@@]34C(=O)O[C@H]5[C@]3(C2)[C@@]6([C@@H]([C@H]5O)C(C)(C)C)[C@H](C(=O)OC6O4)O)O |
| InChI | InChI=1S/C20H24O10/c1-6-12(23)27-7-5-17-11-8(21)9(16(2,3)4)18(17)10(22)13(24)29-15(18)30-20(17,14(25)28-11)19(6,7)26/h6-11,15,21-22,26H,5H2,1-4H3/t6-,7+,8-,9+,10+,11-,15?,17-,18+,19-,20-/m1/s1 |
| InChIKey | LMEHVEUFNRJAAV-GKDYGBOSSA-N |
| External Database Links |
| nHA(Number of hydrogen bond acceptors) | 10 |
| nHD(Number of hydrogen bond donors) | 3 |
| nRot(Number of rotatable bonds) | 1 |
| nRing(Number of rings) | 6 |
| MaxRing(Number of atoms in the biggest ring) | 12 |
| nHet(Number of heteroatoms) | 10 |
| nRig(Number of rigid bonds) | 27 |
| Flexibility | 0.037 |
| Stereo Centers(Number of stereocenters) | 11 |
| TPSA(Topological polar surface area) | 148.82 |
| logS(The logarithm of aqueous solubility value) | -4.645 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 1.427 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 0.406 |
| Quantitative Estimate of Drug-likeness | 0.314 |
| Synthetic accessibility score | 6.283 |
| Natural Product-likeness score | 3.27 |
| Lipinski Rule | Accepted |
| GSK Rule | Rejected |
| Golden Triangle | Accepted |
| Caco-2 Permeability | -5.529 |
| MDCK Permeability | 0.000102813 |
| Pgp-substrate | 0.953 |
| HIA(human intestinal absorption) | 0.009 |
| F20%(20% Oral Bioavailability) | 0.028 |
| F30%(30% Oral Bioavailability) | 0.944 |
| PPB(Plasma protein binding) | 43.86% |
| VD(Volume Distribution) | 0.576 |
| BBB Penetration(Blood brain barrier penetration) | 0.186 |
| B3 Penetration(Blood brain barrier penetration) | Non-Permeable |
| Fu(The fraction unbound in plasms) | 52.42% |
| CYP1A2 inhibitor | 0.01 |
| CYP1A2 substrate | 0.101 |
| CYP2C19 inhibitor | 0.015 |
| CYP2C19 substrate | 0.401 |
| CYP2C9 inhibitor | 0.004 |
| CYP2C9 substrate | 0.029 |
| CYP2D6 inhibitor | 0.006 |
| CYP2D6 substrate | 0.126 |
| CYP3A4 inhibitor | 0.041 |
| CYP3A4 substrate | 0.109 |
| CL(The clearance of a drug) | 2.206 |
| T1/2 | 0.113 |
| NonBiodegradable Rule | 2 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.787 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.682 |
| IGC50 | 3.881 |
| LC50FM | 4.74 |
| LC50DM | 7.57 |
| NR-AR(Androgen receptor) | 0.992 |
| NR-AR-LBD(Androgen receptor) | 0.829 |
| NR-Aromatase | 0.893 |
| NR-ER(Estrogen receptor) | 0.715 |
| NR-ER-LBD(Estrogen receptor) | 0.029 |
| Skin Sensitization Rule | 1 |
| Skin Sensitization | 0.662 |
| Acute Toxicity Rule | 4 |
| Rat Oral Acute Toxicity | 0.918 |
| hERG Blockers | 0.017 |
| H-HT(The human hepatotoxicity) | 0.092 |
| DILI(Drug-induced liver injury) | 0.642 |
| Eye Corrosion | 0.046 |
| Eye Irritation | 0.063 |
| Respiratory Toxicity | 0.975 |
| AMES Toxicity | 0.671 |
| Carcinogencity | 0.838 |
| SR-ARE(Antioxidant Response Element) | 0.041 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.444 |
| SR-p53 | 0.957 |