| Ingredient Name | [(1S,1'R,3'R,4R,4'R,5S,5'R,6'R,12'S,13'S,16'R,18'S,21'R)-1,4',6',12',17',17'-hexamethyl-18'-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyspiro[3,6-dioxabicyclo[3.1.0]hexane-4,8'-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane]-3'-yl] acetate |
| Pubchem CID | 101182169 |
| Iupac name | [(1S,1'R,3'R,4R,4'R,5S,5'R,6'R,12'S,13'S,16'R,18'S,21'R)-1,4',6',12',17',17'-hexamethyl-18'-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyspiro[3,6-dioxabicyclo[3.1.0]hexane-4,8'-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane]-3'-yl] acetate |
| Molecular Formula | C37H56O10 |
| Molecular Weight | 660.8 |
| Isomeric smiles | C[C@@H]1C[C@]2([C@@H]3[C@@](O3)(CO2)C)OC4[C@H]1[C@]5([C@@H](C[C@@]67C[C@@]68CC[C@@H](C([C@@H]8CC[C@H]7[C@@]5(C4)C)(C)C)O[C@H]9[C@@H]([C@H]([C@@H](CO9)O)O)O)OC(=O)C)C |
| InChI | InChI=1S/C37H56O10/c1-18-12-37(30-33(6,47-30)17-43-37)46-21-13-32(5)23-9-8-22-31(3,4)24(45-29-28(41)27(40)20(39)15-42-29)10-11-35(22)16-36(23,35)14-25(44-19(2)38)34(32,7)26(18)21/h18,20-30,39-41H,8-17H2,1-7H3/t18-,20-,21?,22+,23+,24+,25-,26+,27+,28-,29+,30+,32+,33+,34-,35-,36+,37-/m1/s1 |
| InChIKey | GCMGJWLOGKSUGX-DUGOAQORSA-N |
| External Database Links | HERB2.0: HBIN004083 |
| nHA(Number of hydrogen bond acceptors) | 10 |
| nHD(Number of hydrogen bond donors) | 3 |
| nRot(Number of rotatable bonds) | 4 |
| nRing(Number of rings) | 9 |
| MaxRing(Number of atoms in the biggest ring) | 22 |
| nHet(Number of heteroatoms) | 10 |
| nRig(Number of rigid bonds) | 41 |
| Flexibility | 0.098 |
| Stereo Centers(Number of stereocenters) | 18 |
| TPSA(Topological polar surface area) | 136.44 |
| logS(The logarithm of aqueous solubility value) | -4.841 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 4.196 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 3.905 |
| Quantitative Estimate of Drug-likeness | 0.234 |
| Synthetic accessibility score | 6.924 |
| Natural Product-likeness score | 3.372 |
| Lipinski Rule | Accepted |
| GSK Rule | Rejected |
| Golden Triangle | Rejected |
| Caco-2 Permeability | -5.239 |
| MDCK Permeability | 2.01E-05 |
| Pgp-substrate | 0.007 |
| HIA(human intestinal absorption) | 0.003 |
| F20%(20% Oral Bioavailability) | 0.004 |
| F30%(30% Oral Bioavailability) | 0.189 |
| PPB(Plasma protein binding) | 84.61% |
| VD(Volume Distribution) | 0.858 |
| BBB Penetration(Blood brain barrier penetration) | 0.014 |
| B3 Penetration(Blood brain barrier penetration) | Non-Permeable |
| Fu(The fraction unbound in plasms) | 11.24% |
| CYP1A2 inhibitor | 0.002 |
| CYP1A2 substrate | 0.817 |
| CYP2C19 inhibitor | 0.008 |
| CYP2C19 substrate | 0.787 |
| CYP2C9 inhibitor | 0.078 |
| CYP2C9 substrate | 0.01 |
| CYP2D6 inhibitor | 0.006 |
| CYP2D6 substrate | 0.147 |
| CYP3A4 inhibitor | 0.525 |
| CYP3A4 substrate | 0.317 |
| CL(The clearance of a drug) | 1.417 |
| T1/2 | 0.664 |
| NonBiodegradable Rule | 2 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.776 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.888 |
| IGC50 | 5.1 |
| LC50FM | 6.788 |
| LC50DM | 6.609 |
| NR-AR(Androgen receptor) | 0.059 |
| NR-AR-LBD(Androgen receptor) | 0.988 |
| NR-Aromatase | 0.824 |
| NR-ER(Estrogen receptor) | 0.198 |
| NR-ER-LBD(Estrogen receptor) | 0.032 |
| Skin Sensitization Rule | 4 |
| Skin Sensitization | 0.934 |
| Acute Toxicity Rule | 4 |
| Rat Oral Acute Toxicity | 0.273 |
| hERG Blockers | 0.261 |
| H-HT(The human hepatotoxicity) | 0.231 |
| DILI(Drug-induced liver injury) | 0.223 |
| Eye Corrosion | 0.004 |
| Eye Irritation | 0.016 |
| Respiratory Toxicity | 0.97 |
| AMES Toxicity | 0.811 |
| Carcinogencity | 0.066 |
| SR-ARE(Antioxidant Response Element) | 0.053 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.841 |
| SR-p53 | 0.992 |