| Ingredient Name | [(1S,3S,19R,20R,21R,22R,23S,24R,25R,26R)-19,20,22,23-tetraacetyloxy-21-(acetyloxymethyl)-25,26-dihydroxy-3,15,26-trimethyl-6,16-dioxo-2,5,17-trioxa-11-azapentacyclo[16.7.1.01,21.03,24.07,12]hexacosa-7(12),8,10-trien-15-yl] benzoate |
| Pubchem CID | 101109637 |
| Iupac name | [(1S,3S,19R,20R,21R,22R,23S,24R,25R,26R)-19,20,22,23-tetraacetyloxy-21-(acetyloxymethyl)-25,26-dihydroxy-3,15,26-trimethyl-6,16-dioxo-2,5,17-trioxa-11-azapentacyclo[16.7.1.01,21.03,24.07,12]hexacosa-7(12),8,10-trien-15-yl] benzoate |
| Molecular Formula | C43H49NO19 |
| Molecular Weight | 883.8 |
| Isomeric smiles | CC(=O)OC[C@]12[C@H]([C@H]([C@H]3[C@H]([C@]14[C@](C([C@@H]([C@@H]2OC(=O)C)OC(=O)C)OC(=O)C(CCC5=C(C=CC=N5)C(=O)OC[C@]3(O4)C)(C)OC(=O)C6=CC=CC=C6)(C)O)O)OC(=O)C)OC(=O)C |
| InChI | InChI=1S/C43H49NO19/c1-21(45)55-20-42-34(59-24(4)48)30(57-22(2)46)29-32(50)43(42)41(8,54)33(31(58-23(3)47)35(42)60-25(5)49)61-38(53)39(6,62-36(51)26-13-10-9-11-14-26)17-16-28-27(15-12-18-44-28)37(52)56-19-40(29,7)63-43/h9-15,18,29-35,50,54H,16-17,19-20H2,1-8H3/t29-,30-,31-,32+,33?,34-,35-,39?,40+,41+,42+,43-/m0/s1 |
| InChIKey | VMWSZLNWXFHOTG-GUXHNQOSSA-N |
| External Database Links | HERB2.0: HBIN048273 |
| nHA(Number of hydrogen bond acceptors) | 20 |
| nHD(Number of hydrogen bond donors) | 2 |
| nRot(Number of rotatable bonds) | 14 |
| nRing(Number of rings) | 6 |
| MaxRing(Number of atoms in the biggest ring) | 22 |
| nHet(Number of heteroatoms) | 20 |
| nRig(Number of rigid bonds) | 44 |
| Flexibility | 0.318 |
| Stereo Centers(Number of stereocenters) | 12 |
| TPSA(Topological polar surface area) | 272.98 |
| logS(The logarithm of aqueous solubility value) | -4.144 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 1.924 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 1.165 |
| Quantitative Estimate of Drug-likeness | 0.279 |
| Synthetic accessibility score | 7.674 |
| Natural Product-likeness score | 1.601 |
| Lipinski Rule | Rejected |
| GSK Rule | Rejected |
| Golden Triangle | Rejected |
| Caco-2 Permeability | -5.297 |
| MDCK Permeability | 0.000121828 |
| Pgp-substrate | 0.092 |
| HIA(human intestinal absorption) | 0.956 |
| F20%(20% Oral Bioavailability) | 1 |
| F30%(30% Oral Bioavailability) | 0.997 |
| PPB(Plasma protein binding) | 27.43% |
| VD(Volume Distribution) | 1.108 |
| BBB Penetration(Blood brain barrier penetration) | 0.043 |
| B3 Penetration(Blood brain barrier penetration) | Non-Permeable |
| Fu(The fraction unbound in plasms) | 25.57% |
| CYP1A2 inhibitor | 0.027 |
| CYP1A2 substrate | 0.015 |
| CYP2C19 inhibitor | 0.03 |
| CYP2C19 substrate | 0.055 |
| CYP2C9 inhibitor | 0.046 |
| CYP2C9 substrate | 0.003 |
| CYP2D6 inhibitor | 0.97 |
| CYP2D6 substrate | 0.027 |
| CYP3A4 inhibitor | 0.702 |
| CYP3A4 substrate | 0.275 |
| CL(The clearance of a drug) | 2.273 |
| T1/2 | 0.655 |
| NonBiodegradable Rule | 2 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.627 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.01 |
| IGC50 | 3.986 |
| LC50FM | 5.235 |
| LC50DM | 5.92 |
| NR-AR(Androgen receptor) | 0.018 |
| NR-AR-LBD(Androgen receptor) | 0.039 |
| NR-Aromatase | 0.225 |
| NR-ER(Estrogen receptor) | 0.241 |
| NR-ER-LBD(Estrogen receptor) | 0.244 |
| Skin Sensitization Rule | 1 |
| Skin Sensitization | 0.037 |
| Acute Toxicity Rule | 1 |
| Rat Oral Acute Toxicity | 0.049 |
| hERG Blockers | 0.083 |
| H-HT(The human hepatotoxicity) | 0.978 |
| DILI(Drug-induced liver injury) | 0.972 |
| Eye Corrosion | 0.003 |
| Eye Irritation | 0.018 |
| Respiratory Toxicity | 0.011 |
| AMES Toxicity | 0.028 |
| Carcinogencity | 0.077 |
| SR-ARE(Antioxidant Response Element) | 0.033 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.928 |
| SR-p53 | 0.993 |