| Ingredient Name | 2-[(4S,5S,7S,8R,11S,12S,13S,21R)-13,17,18-trihydroxy-2,10,14-trioxo-5,21-bis[(3,4,5-trihydroxybenzoyl)oxy]-7-[(3,4,5-trihydroxybenzoyl)oxymethyl]-3,6,9,15-tetraoxatetracyclo[10.7.1.14,8.016,20]henicosa-1(19),16(20),17-trien-11-yl]acetic acid |
| Pubchem CID | 99865079 |
| Iupac name | 2-[(4S,5S,7S,8R,11S,12S,13S,21R)-13,17,18-trihydroxy-2,10,14-trioxo-5,21-bis[(3,4,5-trihydroxybenzoyl)oxy]-7-[(3,4,5-trihydroxybenzoyl)oxymethyl]-3,6,9,15-tetraoxatetracyclo[10.7.1.14,8.016,20]henicosa-1(19),16(20),17-trien-11-yl]acetic acid |
| Molecular Formula | C41H32O27 |
| Molecular Weight | 956.7 |
| Isomeric smiles | C1=C(C=C(C(=C1O)O)O)C(=O)OC[C@H]2[C@@H]3[C@H]([C@@H]([C@@H](O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C6=C5[C@H]([C@@H](C(=O)O3)CC(=O)O)[C@@H](C(=O)O6)O)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O |
| InChI | InChI=1S/C41H32O27/c42-15-1-10(2-16(43)26(15)51)35(56)62-9-22-31-33(66-36(57)11-3-17(44)27(52)18(45)4-11)34(41(63-22)68-37(58)12-5-19(46)28(53)20(47)6-12)67-38(59)13-7-21(48)29(54)32-25(13)24(30(55)40(61)65-32)14(8-23(49)50)39(60)64-31/h1-7,14,22,24,30-31,33-34,41-48,51-55H,8-9H2,(H,49,50)/t14-,22-,24-,30-,31+,33+,34-,41-/m0/s1 |
| InChIKey | YGVHOSGNOYKRIH-PWTQUAFHSA-N |
| External Database Links |
| nHA(Number of hydrogen bond acceptors) | 27 |
| nHD(Number of hydrogen bond donors) | 13 |
| nRot(Number of rotatable bonds) | 12 |
| nRing(Number of rings) | 7 |
| MaxRing(Number of atoms in the biggest ring) | 19 |
| nHet(Number of heteroatoms) | 27 |
| nRig(Number of rigid bonds) | 49 |
| Flexibility | 0.245 |
| Stereo Centers(Number of stereocenters) | 8 |
| TPSA(Topological polar surface area) | 447.09 |
| logS(The logarithm of aqueous solubility value) | -3.227 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 1.445 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 1.167 |
| Quantitative Estimate of Drug-likeness | 0.045 |
| Synthetic accessibility score | 6.837 |
| Natural Product-likeness score | 1.296 |
| Lipinski Rule | Rejected |
| GSK Rule | Rejected |
| Golden Triangle | Rejected |
| Caco-2 Permeability | -7.046 |
| MDCK Permeability | 2.39E-05 |
| Pgp-substrate | 0.001 |
| HIA(human intestinal absorption) | 0.914 |
| F20%(20% Oral Bioavailability) | 0.432 |
| F30%(30% Oral Bioavailability) | 1 |
| PPB(Plasma protein binding) | 81.86% |
| VD(Volume Distribution) | 0.427 |
| BBB Penetration(Blood brain barrier penetration) | 0.019 |
| B3 Penetration(Blood brain barrier penetration) | Non-Permeable |
| Fu(The fraction unbound in plasms) | 38.62% |
| CYP1A2 inhibitor | 0.156 |
| CYP1A2 substrate | 0.001 |
| CYP2C19 inhibitor | 0.009 |
| CYP2C19 substrate | 0.013 |
| CYP2C9 inhibitor | 0.471 |
| CYP2C9 substrate | 0.026 |
| CYP2D6 inhibitor | 0.002 |
| CYP2D6 substrate | 0.047 |
| CYP3A4 inhibitor | 0.025 |
| CYP3A4 substrate | 0.002 |
| CL(The clearance of a drug) | 11.139 |
| T1/2 | 0.988 |
| NonBiodegradable Rule | 2 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.76 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.002 |
| IGC50 | 3.837 |
| LC50FM | 5.029 |
| LC50DM | 5.957 |
| NR-AR(Androgen receptor) | 0.007 |
| NR-AR-LBD(Androgen receptor) | 0.111 |
| NR-Aromatase | 0.242 |
| NR-ER(Estrogen receptor) | 0.591 |
| NR-ER-LBD(Estrogen receptor) | 0.792 |
| Skin Sensitization Rule | 9 |
| Skin Sensitization | 0.953 |
| Acute Toxicity Rule | 4 |
| Rat Oral Acute Toxicity | 0 |
| hERG Blockers | 0.002 |
| H-HT(The human hepatotoxicity) | 0.074 |
| DILI(Drug-induced liver injury) | 0.968 |
| Eye Corrosion | 0.003 |
| Eye Irritation | 0.922 |
| Respiratory Toxicity | 0.004 |
| AMES Toxicity | 0.045 |
| Carcinogencity | 0.017 |
| SR-ARE(Antioxidant Response Element) | 0.002 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.026 |
| SR-p53 | 0.615 |