| Ingredient Name | 3-O-(2'E,4'Z-decadienoyl)ingenol |
| Pubchem CID | 44575953 |
| Iupac name | [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] (2E,4Z)-deca-2,4-dienoate |
| Molecular Formula | C30H42O6 |
| Molecular Weight | 498.6 |
| Isomeric smiles | CCCCC/C=C\C=C\C(=O)O[C@H]1C(=C[C@@]23[C@@]1([C@@H](C(=C[C@H](C2=O)[C@H]4[C@H](C4(C)C)C[C@H]3C)CO)O)O)C |
| InChI | InChI=1S/C30H42O6/c1-6-7-8-9-10-11-12-13-23(32)36-27-18(2)16-29-19(3)14-22-24(28(22,4)5)21(26(29)34)15-20(17-31)25(33)30(27,29)35/h10-13,15-16,19,21-22,24-25,27,31,33,35H,6-9,14,17H2,1-5H3/b11-10-,13-12+/t19-,21+,22-,24+,25-,27+,29+,30+/m1/s1 |
| InChIKey | XMXZQPNIMGCMHC-JFSCPWEMSA-N |
| External Database Links | ChEMBL: CHEMBL486883 |
| nHA(Number of hydrogen bond acceptors) | 6 |
| nHD(Number of hydrogen bond donors) | 3 |
| nRot(Number of rotatable bonds) | 9 |
| nRing(Number of rings) | 4 |
| MaxRing(Number of atoms in the biggest ring) | 14 |
| nHet(Number of heteroatoms) | 6 |
| nRig(Number of rigid bonds) | 22 |
| Flexibility | 0.409 |
| Stereo Centers(Number of stereocenters) | 8 |
| TPSA(Topological polar surface area) | 104.06 |
| logS(The logarithm of aqueous solubility value) | -4.492 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 4.96 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 4.193 |
| Quantitative Estimate of Drug-likeness | 0.153 |
| Synthetic accessibility score | 6.227 |
| Natural Product-likeness score | 3.271 |
| Lipinski Rule | Accepted |
| GSK Rule | Rejected |
| Golden Triangle | Accepted |
| Caco-2 Permeability | -4.608 |
| MDCK Permeability | 4.93E-05 |
| Pgp-substrate | 0.996 |
| HIA(human intestinal absorption) | 0.016 |
| F20%(20% Oral Bioavailability) | 0.954 |
| F30%(30% Oral Bioavailability) | 0.154 |
| PPB(Plasma protein binding) | 95.53% |
| VD(Volume Distribution) | 1.515 |
| BBB Penetration(Blood brain barrier penetration) | 0.15 |
| B3 Penetration(Blood brain barrier penetration) | Permeable |
| Fu(The fraction unbound in plasms) | 2.06% |
| CYP1A2 inhibitor | 0.111 |
| CYP1A2 substrate | 0.103 |
| CYP2C19 inhibitor | 0.348 |
| CYP2C19 substrate | 0.461 |
| CYP2C9 inhibitor | 0.833 |
| CYP2C9 substrate | 0.092 |
| CYP2D6 inhibitor | 0.17 |
| CYP2D6 substrate | 0.063 |
| CYP3A4 inhibitor | 0.93 |
| CYP3A4 substrate | 0.352 |
| CL(The clearance of a drug) | 8.308 |
| T1/2 | 0.102 |
| NonBiodegradable Rule | 1 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.91 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.974 |
| IGC50 | 5.09 |
| LC50FM | 7.363 |
| LC50DM | 7.583 |
| NR-AR(Androgen receptor) | 0.063 |
| NR-AR-LBD(Androgen receptor) | 0.01 |
| NR-Aromatase | 0.932 |
| NR-ER(Estrogen receptor) | 0.138 |
| NR-ER-LBD(Estrogen receptor) | 0.007 |
| Skin Sensitization Rule | 6 |
| Skin Sensitization | 0.659 |
| Acute Toxicity Rule | 5 |
| Rat Oral Acute Toxicity | 0.944 |
| hERG Blockers | 0.012 |
| H-HT(The human hepatotoxicity) | 0.604 |
| DILI(Drug-induced liver injury) | 0.941 |
| Eye Corrosion | 0.174 |
| Eye Irritation | 0.316 |
| Respiratory Toxicity | 0.984 |
| AMES Toxicity | 0.04 |
| Carcinogencity | 0.075 |
| SR-ARE(Antioxidant Response Element) | 0.731 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.291 |
| SR-p53 | 0.91 |