| Ingredient Name | [(3R)-2-[2-[6-[(2R,3R)-5,7-dihydroxy-3-(3,4,5-trihydroxybenzoyl)oxy-3,4-dihydro-2H-chromen-2-yl]-2,3,4-trihydroxyphenyl]-3,4,5-trihydroxyphenyl]-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| Pubchem CID | 42607505 |
| Iupac name | [(3R)-2-[2-[6-[(2R,3R)-5,7-dihydroxy-3-(3,4,5-trihydroxybenzoyl)oxy-3,4-dihydro-2H-chromen-2-yl]-2,3,4-trihydroxyphenyl]-3,4,5-trihydroxyphenyl]-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| Molecular Formula | C44H34O22 |
| Molecular Weight | 914.7 |
| Isomeric smiles | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3C4=C(C(=C(C=C4C5[C@@H](CC6=C(C=C(C=C6O5)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)O)O)O |
| InChI | InChI=1S/C44H34O22/c45-15-5-21(47)17-11-31(65-43(61)13-1-23(49)35(55)24(50)2-13)41(63-29(17)7-15)19-9-27(53)37(57)39(59)33(19)34-20(10-28(54)38(58)40(34)60)42-32(12-18-22(48)6-16(46)8-30(18)64-42)66-44(62)14-3-25(51)36(56)26(52)4-14/h1-10,31-32,41-42,45-60H,11-12H2/t31-,32-,41-,42?/m1/s1 |
| InChIKey | YUULFXAQUWEYNP-SSKAMGFJSA-N |
| External Database Links |
| nHA(Number of hydrogen bond acceptors) | 22 |
| nHD(Number of hydrogen bond donors) | 16 |
| nRot(Number of rotatable bonds) | 9 |
| nRing(Number of rings) | 8 |
| MaxRing(Number of atoms in the biggest ring) | 10 |
| nHet(Number of heteroatoms) | 22 |
| nRig(Number of rigid bonds) | 48 |
| Flexibility | 0.188 |
| Stereo Centers(Number of stereocenters) | 4 |
| TPSA(Topological polar surface area) | 394.74 |
| logS(The logarithm of aqueous solubility value) | -4.755 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 2.947 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 0.968 |
| Quantitative Estimate of Drug-likeness | 0.078 |
| Synthetic accessibility score | 5.066 |
| Natural Product-likeness score | 0.964 |
| Lipinski Rule | Rejected |
| GSK Rule | Rejected |
| Golden Triangle | Rejected |
| Caco-2 Permeability | -7.388 |
| MDCK Permeability | 2.09E-06 |
| Pgp-substrate | 0 |
| HIA(human intestinal absorption) | 1 |
| F20%(20% Oral Bioavailability) | 1 |
| F30%(30% Oral Bioavailability) | 1 |
| PPB(Plasma protein binding) | 87.20% |
| VD(Volume Distribution) | 0.117 |
| BBB Penetration(Blood brain barrier penetration) | 0 |
| B3 Penetration(Blood brain barrier penetration) | Non-Permeable |
| Fu(The fraction unbound in plasms) | 23.50% |
| CYP1A2 inhibitor | 0.245 |
| CYP1A2 substrate | 0.029 |
| CYP2C19 inhibitor | 0.017 |
| CYP2C19 substrate | 0.016 |
| CYP2C9 inhibitor | 0.365 |
| CYP2C9 substrate | 0.037 |
| CYP2D6 inhibitor | 0 |
| CYP2D6 substrate | 0.111 |
| CYP3A4 inhibitor | 0.011 |
| CYP3A4 substrate | 0.019 |
| CL(The clearance of a drug) | 12.94 |
| T1/2 | 0.934 |
| NonBiodegradable Rule | 1 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.926 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.52 |
| IGC50 | 4.159 |
| LC50FM | 4.83 |
| LC50DM | 6.079 |
| NR-AR(Androgen receptor) | 0 |
| NR-AR-LBD(Androgen receptor) | 0.005 |
| NR-Aromatase | 0.302 |
| NR-ER(Estrogen receptor) | 0.883 |
| NR-ER-LBD(Estrogen receptor) | 0.987 |
| Skin Sensitization Rule | 10 |
| Skin Sensitization | 0.987 |
| Acute Toxicity Rule | 0 |
| Rat Oral Acute Toxicity | 0.002 |
| hERG Blockers | 0.071 |
| H-HT(The human hepatotoxicity) | 0.286 |
| DILI(Drug-induced liver injury) | 0.989 |
| Eye Corrosion | 0.003 |
| Eye Irritation | 0.955 |
| Respiratory Toxicity | 0.001 |
| AMES Toxicity | 0.083 |
| Carcinogencity | 0.006 |
| SR-ARE(Antioxidant Response Element) | 0.057 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.02 |
| SR-p53 | 0.375 |