| Ingredient Name | Rotundioside O |
| Pubchem CID | 16097920 |
| Iupac name | (1S,2R,4S,5R,8R,10S,13S,14R,17S,18R)-10-[(2R,3R,4S,5R,6R)-3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-6-methyloxan-2-yl]oxy-2-hydroxy-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-15-en-21-one |
| Molecular Formula | C48H76O17 |
| Molecular Weight | 925.1 |
| Isomeric smiles | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2O[C@@H]3[C@H]([C@H]([C@H](O[C@H]3O[C@H]4CC[C@]5([C@H](C4(C)C)CC[C@@]6([C@@H]5C=C[C@@]78[C@]6(C[C@H]([C@@]9([C@H]7CC(C(=O)C9)(C)C)CO8)O)C)C)C)C)O)O)CO)O)O)O)O)O |
| InChI | InChI=1S/C48H76O17/c1-21-30(52)33(55)36(58)39(60-21)64-38-35(57)32(54)23(19-49)62-41(38)65-37-34(56)31(53)22(2)61-40(37)63-29-12-13-44(7)24(43(29,5)6)10-14-45(8)25(44)11-15-48-26-16-42(3,4)27(50)18-47(26,20-59-48)28(51)17-46(45,48)9/h11,15,21-26,28-41,49,51-58H,10,12-14,16-20H2,1-9H3/t21-,22+,23+,24-,25+,26+,28+,29-,30-,31-,32+,33+,34-,35-,36+,37+,38+,39-,40-,41-,44-,45+,46-,47+,48-/m0/s1 |
| InChIKey | RYKWBOUIIFTUAC-PGCPYQBQSA-N |
| External Database Links |
| nHA(Number of hydrogen bond acceptors) | 17 |
| nHD(Number of hydrogen bond donors) | 9 |
| nRot(Number of rotatable bonds) | 7 |
| nRing(Number of rings) | 9 |
| MaxRing(Number of atoms in the biggest ring) | 19 |
| nHet(Number of heteroatoms) | 17 |
| nRig(Number of rigid bonds) | 48 |
| Flexibility | 0.146 |
| Stereo Centers(Number of stereocenters) | 25 |
| TPSA(Topological polar surface area) | 263.75 |
| logS(The logarithm of aqueous solubility value) | -4.226 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 2.626 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 2.308 |
| Quantitative Estimate of Drug-likeness | 0.127 |
| Synthetic accessibility score | 7.705 |
| Natural Product-likeness score | 2.585 |
| Lipinski Rule | Rejected |
| GSK Rule | Rejected |
| Golden Triangle | Rejected |
| Caco-2 Permeability | -6.13 |
| MDCK Permeability | 7.87E-05 |
| Pgp-substrate | 0.999 |
| HIA(human intestinal absorption) | 0.95 |
| F20%(20% Oral Bioavailability) | 0.105 |
| F30%(30% Oral Bioavailability) | 0.999 |
| PPB(Plasma protein binding) | 61.29% |
| VD(Volume Distribution) | 0.298 |
| BBB Penetration(Blood brain barrier penetration) | 0.037 |
| B3 Penetration(Blood brain barrier penetration) | Non-Permeable |
| Fu(The fraction unbound in plasms) | 15.54% |
| CYP1A2 inhibitor | 0 |
| CYP1A2 substrate | 0.908 |
| CYP2C19 inhibitor | 0.002 |
| CYP2C19 substrate | 0.538 |
| CYP2C9 inhibitor | 0.002 |
| CYP2C9 substrate | 0.006 |
| CYP2D6 inhibitor | 0.002 |
| CYP2D6 substrate | 0.071 |
| CYP3A4 inhibitor | 0.17 |
| CYP3A4 substrate | 0.048 |
| CL(The clearance of a drug) | 0.716 |
| T1/2 | 0.714 |
| NonBiodegradable Rule | 2 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.957 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.852 |
| IGC50 | 4.748 |
| LC50FM | 6.381 |
| LC50DM | 6.861 |
| NR-AR(Androgen receptor) | 0.143 |
| NR-AR-LBD(Androgen receptor) | 0.475 |
| NR-Aromatase | 0.857 |
| NR-ER(Estrogen receptor) | 0.456 |
| NR-ER-LBD(Estrogen receptor) | 0.458 |
| Skin Sensitization Rule | 2 |
| Skin Sensitization | 0.016 |
| Acute Toxicity Rule | 3 |
| Rat Oral Acute Toxicity | 0.217 |
| hERG Blockers | 0.085 |
| H-HT(The human hepatotoxicity) | 0.245 |
| DILI(Drug-induced liver injury) | 0.01 |
| Eye Corrosion | 0.003 |
| Eye Irritation | 0.006 |
| Respiratory Toxicity | 0.989 |
| AMES Toxicity | 0.064 |
| Carcinogencity | 0.027 |
| SR-ARE(Antioxidant Response Element) | 0.199 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.837 |
| SR-p53 | 0.971 |