| Ingredient Name | Cimicifugoside H1 |
| Pubchem CID | 15241163 |
| Iupac name | (1S,3R,6S,8R,12R,15R,16R,18S)-15-[(2R)-4-[(2R)-3,3-dimethyloxiran-2-yl]-4-oxobutan-2-yl]-18-hydroxy-7,7,12,16-tetramethyl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentacyclo[9.7.0.01,3.03,8.012,16]octadec-10-en-14-one |
| Molecular Formula | C35H52O9 |
| Molecular Weight | 616.8 |
| Isomeric smiles | C[C@H](CC(=O)[C@H]1C(O1)(C)C)[C@H]2C(=O)C[C@@]3([C@@]2(C[C@@H]([C@]45C3=CC[C@@H]6[C@]4(C5)CC[C@@H](C6(C)C)O[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O)O)C)C |
| InChI | InChI=1S/C35H52O9/c1-17(12-18(36)28-31(4,5)44-28)25-19(37)13-32(6)22-9-8-21-30(2,3)24(43-29-27(41)26(40)20(38)15-42-29)10-11-34(21)16-35(22,34)23(39)14-33(25,32)7/h9,17,20-21,23-29,38-41H,8,10-16H2,1-7H3/t17-,20-,21+,23+,24+,25+,26+,27-,28+,29+,32+,33-,34-,35+/m1/s1 |
| InChIKey | PYBFXJMIKJNNAJ-GLWILYKISA-N |
| External Database Links | SymMap: SMIT12869 |
| nHA(Number of hydrogen bond acceptors) | 9 |
| nHD(Number of hydrogen bond donors) | 4 |
| nRot(Number of rotatable bonds) | 6 |
| nRing(Number of rings) | 7 |
| MaxRing(Number of atoms in the biggest ring) | 18 |
| nHet(Number of heteroatoms) | 9 |
| nRig(Number of rigid bonds) | 33 |
| Flexibility | 0.182 |
| Stereo Centers(Number of stereocenters) | 14 |
| TPSA(Topological polar surface area) | 146.05 |
| logS(The logarithm of aqueous solubility value) | -4.448 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 3.353 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 3.099 |
| Quantitative Estimate of Drug-likeness | 0.261 |
| Synthetic accessibility score | 6.57 |
| Natural Product-likeness score | 3.149 |
| Lipinski Rule | Accepted |
| GSK Rule | Rejected |
| Golden Triangle | Rejected |
| Caco-2 Permeability | -5.215 |
| MDCK Permeability | 9.68E-06 |
| Pgp-substrate | 0.732 |
| HIA(human intestinal absorption) | 0.022 |
| F20%(20% Oral Bioavailability) | 0.945 |
| F30%(30% Oral Bioavailability) | 0.95 |
| PPB(Plasma protein binding) | 77.92% |
| VD(Volume Distribution) | 0.595 |
| BBB Penetration(Blood brain barrier penetration) | 0.044 |
| B3 Penetration(Blood brain barrier penetration) | Permeable |
| Fu(The fraction unbound in plasms) | 15.04% |
| CYP1A2 inhibitor | 0.001 |
| CYP1A2 substrate | 0.339 |
| CYP2C19 inhibitor | 0.008 |
| CYP2C19 substrate | 0.831 |
| CYP2C9 inhibitor | 0.038 |
| CYP2C9 substrate | 0.048 |
| CYP2D6 inhibitor | 0.003 |
| CYP2D6 substrate | 0.155 |
| CYP3A4 inhibitor | 0.432 |
| CYP3A4 substrate | 0.305 |
| CL(The clearance of a drug) | 2.38 |
| T1/2 | 0.688 |
| NonBiodegradable Rule | 3 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.952 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.941 |
| IGC50 | 4.598 |
| LC50FM | 6.824 |
| LC50DM | 6.666 |
| NR-AR(Androgen receptor) | 0.853 |
| NR-AR-LBD(Androgen receptor) | 0.962 |
| NR-Aromatase | 0.904 |
| NR-ER(Estrogen receptor) | 0.294 |
| NR-ER-LBD(Estrogen receptor) | 0.017 |
| Skin Sensitization Rule | 3 |
| Skin Sensitization | 0.19 |
| Acute Toxicity Rule | 5 |
| Rat Oral Acute Toxicity | 0.945 |
| hERG Blockers | 0.022 |
| H-HT(The human hepatotoxicity) | 0.263 |
| DILI(Drug-induced liver injury) | 0.083 |
| Eye Corrosion | 0.003 |
| Eye Irritation | 0.009 |
| Respiratory Toxicity | 0.956 |
| AMES Toxicity | 0.514 |
| Carcinogencity | 0.057 |
| SR-ARE(Antioxidant Response Element) | 0.092 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.889 |
| SR-p53 | 0.951 |