| Ingredient Name | Atractyloside I |
| Pubchem CID | 10929902 |
| Iupac name | (4aR,6R,8aS)-4,8a-dimethyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]-1,4a,5,6,7,8-hexahydronaphthalen-2-one |
| Molecular Formula | C27H44O13 |
| Molecular Weight | 576.6 |
| Isomeric smiles | CC1=C(C(=O)C[C@]2([C@H]1C[C@@H](CC2)C(C)(C)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
| InChI | InChI=1S/C27H44O13/c1-11-13-7-12(26(2,3)40-25-22(36)20(34)18(32)16(10-29)38-25)5-6-27(13,4)8-14(30)23(11)39-24-21(35)19(33)17(31)15(9-28)37-24/h12-13,15-22,24-25,28-29,31-36H,5-10H2,1-4H3/t12-,13+,15-,16-,17-,18-,19+,20+,21-,22-,24+,25+,27+/m1/s1 |
| InChIKey | XMFJYFXSIKDRHJ-OJGKPVIHSA-N |
| External Database Links |
| nHA(Number of hydrogen bond acceptors) | 13 |
| nHD(Number of hydrogen bond donors) | 8 |
| nRot(Number of rotatable bonds) | 7 |
| nRing(Number of rings) | 4 |
| MaxRing(Number of atoms in the biggest ring) | 10 |
| nHet(Number of heteroatoms) | 13 |
| nRig(Number of rigid bonds) | 24 |
| Flexibility | 0.292 |
| Stereo Centers(Number of stereocenters) | 13 |
| TPSA(Topological polar surface area) | 215.83 |
| logS(The logarithm of aqueous solubility value) | -2.223 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | -0.874 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 0.341 |
| Quantitative Estimate of Drug-likeness | 0.166 |
| Synthetic accessibility score | 5.347 |
| Natural Product-likeness score | 1.904 |
| Lipinski Rule | Rejected |
| GSK Rule | Rejected |
| Golden Triangle | Rejected |
| Caco-2 Permeability | -6.276 |
| MDCK Permeability | 0.000108819 |
| Pgp-substrate | 0.996 |
| HIA(human intestinal absorption) | 0.981 |
| F20%(20% Oral Bioavailability) | 0.022 |
| F30%(30% Oral Bioavailability) | 0.993 |
| PPB(Plasma protein binding) | 50.53% |
| VD(Volume Distribution) | 0.412 |
| BBB Penetration(Blood brain barrier penetration) | 0.112 |
| B3 Penetration(Blood brain barrier penetration) | Non-Permeable |
| Fu(The fraction unbound in plasms) | 20.55% |
| CYP1A2 inhibitor | 0.009 |
| CYP1A2 substrate | 0.082 |
| CYP2C19 inhibitor | 0.004 |
| CYP2C19 substrate | 0.331 |
| CYP2C9 inhibitor | 0.001 |
| CYP2C9 substrate | 0.03 |
| CYP2D6 inhibitor | 0.009 |
| CYP2D6 substrate | 0.072 |
| CYP3A4 inhibitor | 0.015 |
| CYP3A4 substrate | 0.036 |
| CL(The clearance of a drug) | 1.032 |
| T1/2 | 0.664 |
| NonBiodegradable Rule | 2 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.148 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.003 |
| IGC50 | 2.196 |
| LC50FM | 3.185 |
| LC50DM | 3.951 |
| NR-AR(Androgen receptor) | 0.779 |
| NR-AR-LBD(Androgen receptor) | 0.229 |
| NR-Aromatase | 0.245 |
| NR-ER(Estrogen receptor) | 0.618 |
| NR-ER-LBD(Estrogen receptor) | 0.227 |
| Skin Sensitization Rule | 5 |
| Skin Sensitization | 0.092 |
| Acute Toxicity Rule | 4 |
| Rat Oral Acute Toxicity | 0.014 |
| hERG Blockers | 0.131 |
| H-HT(The human hepatotoxicity) | 0.199 |
| DILI(Drug-induced liver injury) | 0.157 |
| Eye Corrosion | 0.003 |
| Eye Irritation | 0.012 |
| Respiratory Toxicity | 0.026 |
| AMES Toxicity | 0.108 |
| Carcinogencity | 0.03 |
| SR-ARE(Antioxidant Response Element) | 0.189 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.041 |
| SR-p53 | 0.344 |