| Ingredient Name | 2beta-(3,4-Dimethoxyphenyl)-3alpha-methyl-3aalpha-methoxy-5-allyl-2,3,3a,6-tetrahydrobenzofuran-6-one |
| Pubchem CID | 10915273 |
| Iupac name | (2R,3S,3aS)-2-(3,4-dimethoxyphenyl)-3a-methoxy-3-methyl-5-prop-2-enyl-2,3-dihydro-1-benzofuran-6-one |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.4 |
| Isomeric smiles | C[C@H]1[C@@H](OC2=CC(=O)C(=C[C@]12OC)CC=C)C3=CC(=C(C=C3)OC)OC |
| InChI | InChI=1S/C21H24O5/c1-6-7-15-12-21(25-5)13(2)20(26-19(21)11-16(15)22)14-8-9-17(23-3)18(10-14)24-4/h6,8-13,20H,1,7H2,2-5H3/t13-,20+,21-/m0/s1 |
| InChIKey | VDYACOATPFOZIO-DYXDTQHNSA-N |
| External Database Links | HERB2.0: HBIN023341 TCMSID: 13353 |
| nHA(Number of hydrogen bond acceptors) | 5 |
| nHD(Number of hydrogen bond donors) | 0 |
| nRot(Number of rotatable bonds) | 6 |
| nRing(Number of rings) | 3 |
| MaxRing(Number of atoms in the biggest ring) | 9 |
| nHet(Number of heteroatoms) | 5 |
| nRig(Number of rigid bonds) | 18 |
| Flexibility | 0.333 |
| Stereo Centers(Number of stereocenters) | 3 |
| TPSA(Topological polar surface area) | 53.99 |
| logS(The logarithm of aqueous solubility value) | -4.536 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 3.193 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 2.938 |
| Quantitative Estimate of Drug-likeness | 0.727 |
| Synthetic accessibility score | 4.064 |
| Natural Product-likeness score | 2.222 |
| Lipinski Rule | Accepted |
| GSK Rule | Accepted |
| Golden Triangle | Accepted |
| Caco-2 Permeability | -4.567 |
| MDCK Permeability | 1.48E-05 |
| Pgp-substrate | 0.001 |
| HIA(human intestinal absorption) | 0.015 |
| F20%(20% Oral Bioavailability) | 0.043 |
| F30%(30% Oral Bioavailability) | 0.716 |
| PPB(Plasma protein binding) | 85.12% |
| VD(Volume Distribution) | 1.144 |
| BBB Penetration(Blood brain barrier penetration) | 0.229 |
| B3 Penetration(Blood brain barrier penetration) | Permeable |
| Fu(The fraction unbound in plasms) | 7.76% |
| CYP1A2 inhibitor | 0.245 |
| CYP1A2 substrate | 0.956 |
| CYP2C19 inhibitor | 0.799 |
| CYP2C19 substrate | 0.835 |
| CYP2C9 inhibitor | 0.664 |
| CYP2C9 substrate | 0.236 |
| CYP2D6 inhibitor | 0.775 |
| CYP2D6 substrate | 0.383 |
| CYP3A4 inhibitor | 0.92 |
| CYP3A4 substrate | 0.865 |
| CL(The clearance of a drug) | 9.131 |
| T1/2 | 0.447 |
| NonBiodegradable Rule | 2 |
| Pfizer Rule | Rejected |
| SR-MMP | 0.437 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.75 |
| IGC50 | 3.99 |
| LC50FM | 6.072 |
| LC50DM | 5.998 |
| NR-AR(Androgen receptor) | 0.831 |
| NR-AR-LBD(Androgen receptor) | 0.277 |
| NR-Aromatase | 0.79 |
| NR-ER(Estrogen receptor) | 0.414 |
| NR-ER-LBD(Estrogen receptor) | 0.061 |
| Skin Sensitization Rule | 3 |
| Skin Sensitization | 0.852 |
| Acute Toxicity Rule | 2 |
| Rat Oral Acute Toxicity | 0.447 |
| hERG Blockers | 0.088 |
| H-HT(The human hepatotoxicity) | 0.605 |
| DILI(Drug-induced liver injury) | 0.174 |
| Eye Corrosion | 0.004 |
| Eye Irritation | 0.025 |
| Respiratory Toxicity | 0.974 |
| AMES Toxicity | 0.04 |
| Carcinogencity | 0.913 |
| SR-ARE(Antioxidant Response Element) | 0.696 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.052 |
| SR-p53 | 0.791 |