| Ingredient Name | (2S,3S,4S,5R,6S)-6-[[(3S,6aR,6bS,8S,8aS,14bR)-8-hydroxy-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Pubchem CID | 9917314 |
| Iupac name | (2S,3S,4S,5R,6S)-6-[[(3S,6aR,6bS,8S,8aS,14bR)-8-hydroxy-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Molecular Formula | C36H58O9 |
| Molecular Weight | 634.8 |
| Isomeric smiles | C[C@]12CC[C@@H](C(C1CC[C@@]3(C2CC=C4[C@]3(C[C@@H]([C@@]5(C4CC(CC5)(C)C)CO)O)C)C)(C)C)O[C@@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)O)O)O)O |
| InChI | InChI=1S/C36H58O9/c1-31(2)14-15-36(18-37)20(16-31)19-8-9-22-33(5)12-11-24(44-30-27(41)25(39)26(40)28(45-30)29(42)43)32(3,4)21(33)10-13-34(22,6)35(19,7)17-23(36)38/h8,20-28,30,37-41H,9-18H2,1-7H3,(H,42,43)/t20?,21?,22?,23-,24-,25-,26-,27+,28-,30-,33-,34+,35+,36+/m0/s1 |
| InChIKey | IYGXHRZVCNKBPQ-SEFWGABYSA-N |
| External Database Links | HERB2.0: HBIN033529 TCMSID: 16953 |
| nHA(Number of hydrogen bond acceptors) | 9 |
| nHD(Number of hydrogen bond donors) | 6 |
| nRot(Number of rotatable bonds) | 4 |
| nRing(Number of rings) | 6 |
| MaxRing(Number of atoms in the biggest ring) | 22 |
| nHet(Number of heteroatoms) | 9 |
| nRig(Number of rigid bonds) | 33 |
| Flexibility | 0.121 |
| Stereo Centers(Number of stereocenters) | 14 |
| TPSA(Topological polar surface area) | 156.91 |
| logS(The logarithm of aqueous solubility value) | -3.961 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 3.956 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 3.554 |
| Quantitative Estimate of Drug-likeness | 0.199 |
| Synthetic accessibility score | 5.434 |
| Natural Product-likeness score | 3.11 |
| Lipinski Rule | Rejected |
| GSK Rule | Rejected |
| Golden Triangle | Rejected |
| Caco-2 Permeability | -5.42 |
| MDCK Permeability | 1.39E-05 |
| Pgp-substrate | 0.007 |
| HIA(human intestinal absorption) | 0.08 |
| F20%(20% Oral Bioavailability) | 0.017 |
| F30%(30% Oral Bioavailability) | 0.084 |
| PPB(Plasma protein binding) | 93.69% |
| VD(Volume Distribution) | 0.558 |
| BBB Penetration(Blood brain barrier penetration) | 0.085 |
| B3 Penetration(Blood brain barrier penetration) | Permeable |
| Fu(The fraction unbound in plasms) | 6.22% |
| CYP1A2 inhibitor | 0.002 |
| CYP1A2 substrate | 0.131 |
| CYP2C19 inhibitor | 0.003 |
| CYP2C19 substrate | 0.562 |
| CYP2C9 inhibitor | 0.045 |
| CYP2C9 substrate | 0.076 |
| CYP2D6 inhibitor | 0.006 |
| CYP2D6 substrate | 0.115 |
| CYP3A4 inhibitor | 0.11 |
| CYP3A4 substrate | 0.04 |
| CL(The clearance of a drug) | 1.024 |
| T1/2 | 0.117 |
| NonBiodegradable Rule | 1 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.928 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.915 |
| IGC50 | 4.456 |
| LC50FM | 5.12 |
| LC50DM | 5.662 |
| NR-AR(Androgen receptor) | 0.955 |
| NR-AR-LBD(Androgen receptor) | 0.919 |
| NR-Aromatase | 0.815 |
| NR-ER(Estrogen receptor) | 0.66 |
| NR-ER-LBD(Estrogen receptor) | 0.049 |
| Skin Sensitization Rule | 1 |
| Skin Sensitization | 0.048 |
| Acute Toxicity Rule | 2 |
| Rat Oral Acute Toxicity | 0.133 |
| hERG Blockers | 0.011 |
| H-HT(The human hepatotoxicity) | 0.285 |
| DILI(Drug-induced liver injury) | 0.012 |
| Eye Corrosion | 0.003 |
| Eye Irritation | 0.012 |
| Respiratory Toxicity | 0.977 |
| AMES Toxicity | 0.032 |
| Carcinogencity | 0.169 |
| SR-ARE(Antioxidant Response Element) | 0.451 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.061 |
| SR-p53 | 0.842 |