| Ingredient Name | 2-[4-hydroxy-2-(hydroxymethyl)-6-[(1S,2S,4S,5'R,6R,7S,8R,9S,12S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]oxy-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
| Pubchem CID | 5458956 |
| Iupac name | 2-[4-hydroxy-2-(hydroxymethyl)-6-[(1S,2S,4S,5'R,6R,7S,8R,9S,12S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]oxy-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
| Molecular Formula | C45H73NO15 |
| Molecular Weight | 868.1 |
| Isomeric smiles | C[C@@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)NC1 |
| InChI | InChI=1S/C45H73NO15/c1-19-9-14-45(46-17-19)20(2)30-28(61-45)16-27-25-8-7-23-15-24(10-12-43(23,5)26(25)11-13-44(27,30)6)57-42-39(60-41-36(53)34(51)32(49)22(4)56-41)37(54)38(29(18-47)58-42)59-40-35(52)33(50)31(48)21(3)55-40/h7,19-22,24-42,46-54H,8-18H2,1-6H3/t19-,20+,21?,22?,24+,25-,26+,27+,28+,29?,30+,31?,32?,33?,34?,35?,36?,37?,38?,39?,40?,41?,42?,43+,44+,45-/m1/s1 |
| InChIKey | MBWUSSKCCUMJHO-PUQINFEQSA-N |
| External Database Links |
| nHA(Number of hydrogen bond acceptors) | 16 |
| nHD(Number of hydrogen bond donors) | 9 |
| nRot(Number of rotatable bonds) | 7 |
| nRing(Number of rings) | 9 |
| MaxRing(Number of atoms in the biggest ring) | 20 |
| nHet(Number of heteroatoms) | 16 |
| nRig(Number of rigid bonds) | 48 |
| Flexibility | 0.146 |
| Stereo Centers(Number of stereocenters) | 26 |
| TPSA(Topological polar surface area) | 238.48 |
| logS(The logarithm of aqueous solubility value) | -2.408 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 2.396 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 3.03 |
| Quantitative Estimate of Drug-likeness | 0.161 |
| Synthetic accessibility score | 6.751 |
| Natural Product-likeness score | 2.384 |
| Lipinski Rule | Rejected |
| GSK Rule | Rejected |
| Golden Triangle | Rejected |
| Caco-2 Permeability | -5.975 |
| MDCK Permeability | 0.000171122 |
| Pgp-substrate | 0.068 |
| HIA(human intestinal absorption) | 0.995 |
| F20%(20% Oral Bioavailability) | 0.361 |
| F30%(30% Oral Bioavailability) | 0.996 |
| PPB(Plasma protein binding) | 39.83% |
| VD(Volume Distribution) | 0.081 |
| BBB Penetration(Blood brain barrier penetration) | 0.135 |
| B3 Penetration(Blood brain barrier penetration) | Non-Permeable |
| Fu(The fraction unbound in plasms) | 21.71% |
| CYP1A2 inhibitor | 0 |
| CYP1A2 substrate | 0.138 |
| CYP2C19 inhibitor | 0.001 |
| CYP2C19 substrate | 0.339 |
| CYP2C9 inhibitor | 0 |
| CYP2C9 substrate | 0.031 |
| CYP2D6 inhibitor | 0.001 |
| CYP2D6 substrate | 0.143 |
| CYP3A4 inhibitor | 0.018 |
| CYP3A4 substrate | 0.056 |
| CL(The clearance of a drug) | 0.575 |
| T1/2 | 0.12 |
| NonBiodegradable Rule | 1 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.793 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.87 |
| IGC50 | 3.628 |
| LC50FM | 4.873 |
| LC50DM | 5.397 |
| NR-AR(Androgen receptor) | 0.003 |
| NR-AR-LBD(Androgen receptor) | 0.24 |
| NR-Aromatase | 0.057 |
| NR-ER(Estrogen receptor) | 0.236 |
| NR-ER-LBD(Estrogen receptor) | 0.354 |
| Skin Sensitization Rule | 1 |
| Skin Sensitization | 0.041 |
| Acute Toxicity Rule | 0 |
| Rat Oral Acute Toxicity | 0.197 |
| hERG Blockers | 0.871 |
| H-HT(The human hepatotoxicity) | 0.251 |
| DILI(Drug-induced liver injury) | 0.022 |
| Eye Corrosion | 0.003 |
| Eye Irritation | 0.002 |
| Respiratory Toxicity | 0.972 |
| AMES Toxicity | 0.211 |
| Carcinogencity | 0.426 |
| SR-ARE(Antioxidant Response Element) | 0.298 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.553 |
| SR-p53 | 0.766 |