| Ingredient Name | methyl (Z)-6-[(10S,13R,17S)-3,15-dihydroxy-4,4,10,13,14,17-hexamethyl-7,11-dioxo-1,2,3,5,6,12,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-methyl-4-oxohept-5-enoate |
| Pubchem CID | 5319661 |
| Iupac name | methyl (Z)-6-[(10S,13R,17S)-3,15-dihydroxy-4,4,10,13,14,17-hexamethyl-7,11-dioxo-1,2,3,5,6,12,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-methyl-4-oxohept-5-enoate |
| Molecular Formula | C32H46O7 |
| Molecular Weight | 542.7 |
| Isomeric smiles | CC(CC(=O)/C=C(/C)\[C@@]1(CC(C2([C@@]1(CC(=O)C3=C2C(=O)CC4[C@@]3(CCC(C4(C)C)O)C)C)C)O)C)C(=O)OC |
| InChI | InChI=1S/C32H46O7/c1-17(27(38)39-9)12-19(33)13-18(2)30(6)16-24(37)32(8)26-20(34)14-22-28(3,4)23(36)10-11-29(22,5)25(26)21(35)15-31(30,32)7/h13,17,22-24,36-37H,10-12,14-16H2,1-9H3/b18-13-/t17?,22?,23?,24?,29-,30-,31+,32?/m0/s1 |
| InChIKey | LHWMZHJFDMVPPP-ZPTOFWMHSA-N |
| External Database Links | HERB2.0: HBIN035236 TCMSID: 15497 |
| nHA(Number of hydrogen bond acceptors) | 7 |
| nHD(Number of hydrogen bond donors) | 2 |
| nRot(Number of rotatable bonds) | 6 |
| nRing(Number of rings) | 4 |
| MaxRing(Number of atoms in the biggest ring) | 17 |
| nHet(Number of heteroatoms) | 7 |
| nRig(Number of rigid bonds) | 25 |
| Flexibility | 0.24 |
| Stereo Centers(Number of stereocenters) | 8 |
| TPSA(Topological polar surface area) | 117.97 |
| logS(The logarithm of aqueous solubility value) | -4.811 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 3.051 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 2.673 |
| Quantitative Estimate of Drug-likeness | 0.387 |
| Synthetic accessibility score | 5.332 |
| Natural Product-likeness score | 2.104 |
| Lipinski Rule | Accepted |
| GSK Rule | Rejected |
| Golden Triangle | Rejected |
| Caco-2 Permeability | -5.211 |
| MDCK Permeability | 2.14E-05 |
| Pgp-substrate | 0.01 |
| HIA(human intestinal absorption) | 0.03 |
| F20%(20% Oral Bioavailability) | 0.023 |
| F30%(30% Oral Bioavailability) | 0.663 |
| PPB(Plasma protein binding) | 78.49% |
| VD(Volume Distribution) | 0.406 |
| BBB Penetration(Blood brain barrier penetration) | 0.764 |
| B3 Penetration(Blood brain barrier penetration) | Non-Permeable |
| Fu(The fraction unbound in plasms) | 18.75% |
| CYP1A2 inhibitor | 0.003 |
| CYP1A2 substrate | 0.648 |
| CYP2C19 inhibitor | 0.082 |
| CYP2C19 substrate | 0.894 |
| CYP2C9 inhibitor | 0.062 |
| CYP2C9 substrate | 0.031 |
| CYP2D6 inhibitor | 0.002 |
| CYP2D6 substrate | 0.041 |
| CYP3A4 inhibitor | 0.814 |
| CYP3A4 substrate | 0.851 |
| CL(The clearance of a drug) | 11.832 |
| T1/2 | 0.066 |
| NonBiodegradable Rule | 1 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.902 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.922 |
| IGC50 | 4.852 |
| LC50FM | 4.045 |
| LC50DM | 4.439 |
| NR-AR(Androgen receptor) | 0.335 |
| NR-AR-LBD(Androgen receptor) | 0.753 |
| NR-Aromatase | 0.815 |
| NR-ER(Estrogen receptor) | 0.146 |
| NR-ER-LBD(Estrogen receptor) | 0.677 |
| Skin Sensitization Rule | 4 |
| Skin Sensitization | 0.11 |
| Acute Toxicity Rule | 3 |
| Rat Oral Acute Toxicity | 0.155 |
| hERG Blockers | 0.012 |
| H-HT(The human hepatotoxicity) | 0.403 |
| DILI(Drug-induced liver injury) | 0.159 |
| Eye Corrosion | 0.003 |
| Eye Irritation | 0.008 |
| Respiratory Toxicity | 0.974 |
| AMES Toxicity | 0.055 |
| Carcinogencity | 0.558 |
| SR-ARE(Antioxidant Response Element) | 0.92 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.781 |
| SR-p53 | 0.94 |