| Ingredient Name | 7-(6-O-beta-D-Xylopyranosyl-beta-D-glucopyranosyloxy)-4'-methoxy-3-hydroxyflavanone |
| Pubchem CID | 5318898 |
| Iupac name | 3-hydroxy-2-(4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
| Molecular Formula | C27H32O14 |
| Molecular Weight | 580.5 |
| Isomeric smiles | COC1=CC=C(C=C1)C2C(C(=O)C3=C(O2)C=C(C=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO[C@H]5[C@@H]([C@H]([C@@H](CO5)O)O)O)O)O)O)O |
| InChI | InChI=1S/C27H32O14/c1-36-12-4-2-11(3-5-12)25-22(33)18(29)14-7-6-13(8-16(14)40-25)39-27-24(35)21(32)20(31)17(41-27)10-38-26-23(34)19(30)15(28)9-37-26/h2-8,15,17,19-28,30-35H,9-10H2,1H3/t15-,17-,19+,20-,21+,22?,23-,24-,25?,26+,27-/m1/s1 |
| InChIKey | VMXSTASPQYHBRM-MRJHZWQBSA-N |
| External Database Links | HERB2.0: HBIN032392 TCMSID: 15275 |
| nHA(Number of hydrogen bond acceptors) | 14 |
| nHD(Number of hydrogen bond donors) | 7 |
| nRot(Number of rotatable bonds) | 7 |
| nRing(Number of rings) | 5 |
| MaxRing(Number of atoms in the biggest ring) | 10 |
| nHet(Number of heteroatoms) | 14 |
| nRig(Number of rigid bonds) | 30 |
| Flexibility | 0.233 |
| Stereo Centers(Number of stereocenters) | 11 |
| TPSA(Topological polar surface area) | 214.06 |
| logS(The logarithm of aqueous solubility value) | -3.698 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | -0.257 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | -0.057 |
| Quantitative Estimate of Drug-likeness | 0.189 |
| Synthetic accessibility score | 4.687 |
| Natural Product-likeness score | 1.801 |
| Lipinski Rule | Rejected |
| GSK Rule | Rejected |
| Golden Triangle | Rejected |
| Caco-2 Permeability | -6.397 |
| MDCK Permeability | 3.73E-05 |
| Pgp-substrate | 0.991 |
| HIA(human intestinal absorption) | 0.853 |
| F20%(20% Oral Bioavailability) | 0.001 |
| F30%(30% Oral Bioavailability) | 0.998 |
| PPB(Plasma protein binding) | 55.86% |
| VD(Volume Distribution) | 0.513 |
| BBB Penetration(Blood brain barrier penetration) | 0.15 |
| B3 Penetration(Blood brain barrier penetration) | Non-Permeable |
| Fu(The fraction unbound in plasms) | 13.73% |
| CYP1A2 inhibitor | 0.018 |
| CYP1A2 substrate | 0.047 |
| CYP2C19 inhibitor | 0.03 |
| CYP2C19 substrate | 0.252 |
| CYP2C9 inhibitor | 0.003 |
| CYP2C9 substrate | 0.19 |
| CYP2D6 inhibitor | 0.025 |
| CYP2D6 substrate | 0.276 |
| CYP3A4 inhibitor | 0.017 |
| CYP3A4 substrate | 0.061 |
| CL(The clearance of a drug) | 0.98 |
| T1/2 | 0.257 |
| NonBiodegradable Rule | 1 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.162 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.004 |
| IGC50 | 4.382 |
| LC50FM | 5.329 |
| LC50DM | 6.881 |
| NR-AR(Androgen receptor) | 0.396 |
| NR-AR-LBD(Androgen receptor) | 0.634 |
| NR-Aromatase | 0.56 |
| NR-ER(Estrogen receptor) | 0.346 |
| NR-ER-LBD(Estrogen receptor) | 0.19 |
| Skin Sensitization Rule | 3 |
| Skin Sensitization | 0.365 |
| Acute Toxicity Rule | 3 |
| Rat Oral Acute Toxicity | 0.033 |
| hERG Blockers | 0.293 |
| H-HT(The human hepatotoxicity) | 0.057 |
| DILI(Drug-induced liver injury) | 0.916 |
| Eye Corrosion | 0.003 |
| Eye Irritation | 0.031 |
| Respiratory Toxicity | 0.008 |
| AMES Toxicity | 0.16 |
| Carcinogencity | 0.589 |
| SR-ARE(Antioxidant Response Element) | 0.123 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.129 |
| SR-p53 | 0.626 |