| Ingredient Name | (8R,10R,13R)-17-[(2R)-1,2-dihydroxy-6-methylhept-5-en-2-yl]-4,4,8,10,14-pentamethyl-1,2,5,6,7,9,11,12,13,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| Pubchem CID | 5316971 |
| Iupac name | (8R,10R,13R)-17-[(2R)-1,2-dihydroxy-6-methylhept-5-en-2-yl]-4,4,8,10,14-pentamethyl-1,2,5,6,7,9,11,12,13,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| Molecular Formula | C30H50O3 |
| Molecular Weight | 458.7 |
| Isomeric smiles | CC(=CCC[C@](CO)(C1CCC2([C@@H]1CCC3[C@]2(CCC4[C@@]3(CCC(=O)C4(C)C)C)C)C)O)C |
| InChI | InChI=1S/C30H50O3/c1-20(2)9-8-15-30(33,19-31)22-12-17-28(6)21(22)10-11-24-27(5)16-14-25(32)26(3,4)23(27)13-18-29(24,28)7/h9,21-24,31,33H,8,10-19H2,1-7H3/t21-,22?,23?,24?,27+,28?,29-,30+/m1/s1 |
| InChIKey | UFJPCTSKTPSJTK-DHTYZGBJSA-N |
| External Database Links | TCMSID: 13274 |
| nHA(Number of hydrogen bond acceptors) | 3 |
| nHD(Number of hydrogen bond donors) | 2 |
| nRot(Number of rotatable bonds) | 5 |
| nRing(Number of rings) | 4 |
| MaxRing(Number of atoms in the biggest ring) | 17 |
| nHet(Number of heteroatoms) | 3 |
| nRig(Number of rigid bonds) | 22 |
| Flexibility | 0.227 |
| Stereo Centers(Number of stereocenters) | 8 |
| TPSA(Topological polar surface area) | 57.53 |
| logS(The logarithm of aqueous solubility value) | -5.603 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 5.656 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 4.551 |
| Quantitative Estimate of Drug-likeness | 0.45 |
| Synthetic accessibility score | 4.814 |
| Natural Product-likeness score | 3.036 |
| Lipinski Rule | Accepted |
| GSK Rule | Rejected |
| Golden Triangle | Accepted |
| Caco-2 Permeability | -4.986 |
| MDCK Permeability | 1.31E-05 |
| Pgp-substrate | 0 |
| HIA(human intestinal absorption) | 0.009 |
| F20%(20% Oral Bioavailability) | 0.684 |
| F30%(30% Oral Bioavailability) | 0.957 |
| PPB(Plasma protein binding) | 97.06% |
| VD(Volume Distribution) | 1.086 |
| BBB Penetration(Blood brain barrier penetration) | 0.682 |
| B3 Penetration(Blood brain barrier penetration) | Permeable |
| Fu(The fraction unbound in plasms) | 1.44% |
| CYP1A2 inhibitor | 0.046 |
| CYP1A2 substrate | 0.456 |
| CYP2C19 inhibitor | 0.078 |
| CYP2C19 substrate | 0.947 |
| CYP2C9 inhibitor | 0.192 |
| CYP2C9 substrate | 0.729 |
| CYP2D6 inhibitor | 0.022 |
| CYP2D6 substrate | 0.581 |
| CYP3A4 inhibitor | 0.322 |
| CYP3A4 substrate | 0.218 |
| CL(The clearance of a drug) | 7.639 |
| T1/2 | 0.112 |
| NonBiodegradable Rule | 1 |
| Pfizer Rule | Rejected |
| SR-MMP | 0.716 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.073 |
| IGC50 | 5.189 |
| LC50FM | 6.24 |
| LC50DM | 6.206 |
| NR-AR(Androgen receptor) | 0.044 |
| NR-AR-LBD(Androgen receptor) | 0.261 |
| NR-Aromatase | 0.495 |
| NR-ER(Estrogen receptor) | 0.123 |
| NR-ER-LBD(Estrogen receptor) | 0.138 |
| Skin Sensitization Rule | 1 |
| Skin Sensitization | 0.345 |
| Acute Toxicity Rule | 2 |
| Rat Oral Acute Toxicity | 0.017 |
| hERG Blockers | 0.026 |
| H-HT(The human hepatotoxicity) | 0.389 |
| DILI(Drug-induced liver injury) | 0.02 |
| Eye Corrosion | 0.017 |
| Eye Irritation | 0.209 |
| Respiratory Toxicity | 0.895 |
| AMES Toxicity | 0.005 |
| Carcinogencity | 0.013 |
| SR-ARE(Antioxidant Response Element) | 0.208 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.012 |
| SR-p53 | 0.057 |