| Ingredient Name | Danshenol B |
| Pubchem CID | 3083515 |
| Iupac name | (1R,10S)-10-hydroxy-1,6,6-trimethyl-10-(2-oxopropyl)-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-11-one |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.4 |
| Isomeric smiles | C[C@H]1COC2=C1C(=O)[C@@](C3=C2C=CC4=C3CCCC4(C)C)(CC(=O)C)O |
| InChI | InChI=1S/C22H26O4/c1-12-11-26-19-15-7-8-16-14(6-5-9-21(16,3)4)18(15)22(25,10-13(2)23)20(24)17(12)19/h7-8,12,25H,5-6,9-11H2,1-4H3/t12-,22-/m0/s1 |
| InChIKey | KZLPKGGMSDHTRS-YTEVENLXSA-N |
| External Database Links | HERB2.0: HBIN022646 SymMap: SMIT08589 TCM-ID: TCMC4238 TCMSID: 6903 TCMSP: 7081 TCMSuite: 52381 ChEMBL: CHEMBL2261307 |
| nHA(Number of hydrogen bond acceptors) | 4 |
| nHD(Number of hydrogen bond donors) | 1 |
| nRot(Number of rotatable bonds) | 2 |
| nRing(Number of rings) | 4 |
| MaxRing(Number of atoms in the biggest ring) | 17 |
| nHet(Number of heteroatoms) | 4 |
| nRig(Number of rigid bonds) | 22 |
| Flexibility | 0.091 |
| Stereo Centers(Number of stereocenters) | 2 |
| TPSA(Topological polar surface area) | 63.6 |
| logS(The logarithm of aqueous solubility value) | -4.912 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 4.202 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 3.477 |
| Quantitative Estimate of Drug-likeness | 0.884 |
| Synthetic accessibility score | 4.177 |
| Natural Product-likeness score | 2.181 |
| Lipinski Rule | Accepted |
| GSK Rule | Rejected |
| Golden Triangle | Accepted |
| Caco-2 Permeability | -4.902 |
| MDCK Permeability | 2.51E-05 |
| Pgp-substrate | 0.044 |
| HIA(human intestinal absorption) | 0.01 |
| F20%(20% Oral Bioavailability) | 0.923 |
| F30%(30% Oral Bioavailability) | 0.544 |
| PPB(Plasma protein binding) | 95.54% |
| VD(Volume Distribution) | 1.548 |
| BBB Penetration(Blood brain barrier penetration) | 0.482 |
| B3 Penetration(Blood brain barrier penetration) | Permeable |
| Fu(The fraction unbound in plasms) | 5.74% |
| CYP1A2 inhibitor | 0.938 |
| CYP1A2 substrate | 0.692 |
| CYP2C19 inhibitor | 0.933 |
| CYP2C19 substrate | 0.821 |
| CYP2C9 inhibitor | 0.767 |
| CYP2C9 substrate | 0.191 |
| CYP2D6 inhibitor | 0.907 |
| CYP2D6 substrate | 0.133 |
| CYP3A4 inhibitor | 0.885 |
| CYP3A4 substrate | 0.683 |
| CL(The clearance of a drug) | 0.909 |
| T1/2 | 0.033 |
| NonBiodegradable Rule | 2 |
| Pfizer Rule | Rejected |
| SR-MMP | 0.883 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.953 |
| IGC50 | 4.443 |
| LC50FM | 5.028 |
| LC50DM | 4.666 |
| NR-AR(Androgen receptor) | 0.04 |
| NR-AR-LBD(Androgen receptor) | 0.021 |
| NR-Aromatase | 0.952 |
| NR-ER(Estrogen receptor) | 0.263 |
| NR-ER-LBD(Estrogen receptor) | 0.405 |
| Skin Sensitization Rule | 4 |
| Skin Sensitization | 0.278 |
| Acute Toxicity Rule | 5 |
| Rat Oral Acute Toxicity | 0.717 |
| hERG Blockers | 0.033 |
| H-HT(The human hepatotoxicity) | 0.328 |
| DILI(Drug-induced liver injury) | 0.221 |
| Eye Corrosion | 0.003 |
| Eye Irritation | 0.02 |
| Respiratory Toxicity | 0.753 |
| AMES Toxicity | 0.118 |
| Carcinogencity | 0.287 |
| SR-ARE(Antioxidant Response Element) | 0.697 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.044 |
| SR-p53 | 0.885 |