| Ingredient Name | 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]pyrimidin-2-one; 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-4-hydroxy-hexahydropyrimidin-2-one; 1-[(2R,5R)-5-ethynyl-5-(hydroxymethyl)-2H-furan-2-yl]-5-methyl-pyrimidine-2,4-dione |
| Pubchem CID | 3013329 |
| Iupac name | 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-hydroxy-1,3-diazinan-2-one;1-[(2R,5R)-5-ethynyl-5-(hydroxymethyl)-2H-furan-2-yl]-5-methylpyrimidine-2,4-dione |
| Molecular Formula | C30H41N7O14 |
| Molecular Weight | 723.7 |
| Isomeric smiles | CC1=CN(C(=O)NC1=O)[C@H]2C=C[C@](O2)(CO)C#C.C1CN(C(=O)NC1O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O.C1[C@@H]([C@H](O[C@H]1N2C=CC(=NC2=O)N)CO)O |
| InChI | InChI=1S/C12H12N2O4.C9H13N3O4.C9H16N2O6/c1-3-12(7-15)5-4-9(18-12)14-6-8(2)10(16)13-11(14)17;10-7-1-2-12(9(15)11-7)8-3-5(14)6(4-13)16-8;12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1,4-6,9,15H,7H2,2H3,(H,13,16,17);1-2,5-6,8,13-14H,3-4H2,(H2,10,11,15);4-8,12-15H,1-3H2,(H,10,16)/t9-,12+;5-,6+,8+;4-,5?,6-,7-,8-/m101/s1 |
| InChIKey | DQAUPEHSTBDYQS-QTDUCIPTSA-N |
| External Database Links |
| nHA(Number of hydrogen bond acceptors) | 21 |
| nHD(Number of hydrogen bond donors) | 11 |
| nRot(Number of rotatable bonds) | 6 |
| nRing(Number of rings) | 6 |
| MaxRing(Number of atoms in the biggest ring) | 6 |
| nHet(Number of heteroatoms) | 21 |
| nRig(Number of rigid bonds) | 38 |
| Flexibility | 0.158 |
| Stereo Centers(Number of stereocenters) | 10 |
| TPSA(Topological polar surface area) | 317.41 |
| logS(The logarithm of aqueous solubility value) | -1.507 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | -2.189 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | -1.603 |
| Quantitative Estimate of Drug-likeness | 0.098 |
| Synthetic accessibility score | 5.623 |
| Natural Product-likeness score | 0.986 |
| Lipinski Rule | Rejected |
| GSK Rule | Rejected |
| Golden Triangle | Rejected |
| Caco-2 Permeability | -6.49 |
| MDCK Permeability | 6.12E-05 |
| Pgp-substrate | 0.949 |
| HIA(human intestinal absorption) | 0.976 |
| F20%(20% Oral Bioavailability) | 0.999 |
| F30%(30% Oral Bioavailability) | 1 |
| PPB(Plasma protein binding) | 30.33% |
| VD(Volume Distribution) | 0.252 |
| BBB Penetration(Blood brain barrier penetration) | 0.447 |
| B3 Penetration(Blood brain barrier penetration) | Non-Permeable |
| Fu(The fraction unbound in plasms) | 62.43% |
| CYP1A2 inhibitor | 0.001 |
| CYP1A2 substrate | 0.051 |
| CYP2C19 inhibitor | 0.019 |
| CYP2C19 substrate | 0.049 |
| CYP2C9 inhibitor | 0.004 |
| CYP2C9 substrate | 0.071 |
| CYP2D6 inhibitor | 0.007 |
| CYP2D6 substrate | 0.043 |
| CYP3A4 inhibitor | 0.004 |
| CYP3A4 substrate | 0.029 |
| CL(The clearance of a drug) | 1.7 |
| T1/2 | 0.854 |
| NonBiodegradable Rule | 1 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.115 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.044 |
| IGC50 | 0.553 |
| LC50FM | 1.972 |
| LC50DM | 1.88 |
| NR-AR(Androgen receptor) | 0.003 |
| NR-AR-LBD(Androgen receptor) | 0.003 |
| NR-Aromatase | 0.014 |
| NR-ER(Estrogen receptor) | 0.246 |
| NR-ER-LBD(Estrogen receptor) | 0.181 |
| Skin Sensitization Rule | 2 |
| Skin Sensitization | 0.017 |
| Acute Toxicity Rule | 0 |
| Rat Oral Acute Toxicity | 0 |
| hERG Blockers | 0.014 |
| H-HT(The human hepatotoxicity) | 0.988 |
| DILI(Drug-induced liver injury) | 0.998 |
| Eye Corrosion | 0.003 |
| Eye Irritation | 0.003 |
| Respiratory Toxicity | 0.001 |
| AMES Toxicity | 0.056 |
| Carcinogencity | 0.013 |
| SR-ARE(Antioxidant Response Element) | 0.875 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.033 |
| SR-p53 | 0.943 |