| Ingredient Name | Gibb-3-ene-1,10-dicarboxylic acid, 2,4a,7-trihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1alpha,2beta,4aalpha,4bbeta,10beta)- |
| Pubchem CID | 439551 |
| Iupac name | (1R,2R,5S,8S,9S,10R,12S)-5,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.4 |
| Isomeric smiles | CC12[C@H](C=C[C@@]3([C@@H]1[C@@H]([C@]45[C@H]3CC[C@](C4)(C(=C)C5)O)C(=O)O)OC2=O)O |
| InChI | InChI=1S/C19H22O6/c1-9-7-17-8-18(9,24)5-3-10(17)19-6-4-11(20)16(2,15(23)25-19)13(19)12(17)14(21)22/h4,6,10-13,20,24H,1,3,5,7-8H2,2H3,(H,21,22)/t10-,11+,12-,13-,16?,17+,18+,19-/m1/s1 |
| InChIKey | IXORZMNAPKEEDV-QTWFBFKQSA-N |
| External Database Links | HERB2.0: HBIN027612 DrugBank: DB07814 |
| nHA(Number of hydrogen bond acceptors) | 6 |
| nHD(Number of hydrogen bond donors) | 3 |
| nRot(Number of rotatable bonds) | 1 |
| nRing(Number of rings) | 5 |
| MaxRing(Number of atoms in the biggest ring) | 7 |
| nHet(Number of heteroatoms) | 6 |
| nRig(Number of rigid bonds) | 24 |
| Flexibility | 0.042 |
| Stereo Centers(Number of stereocenters) | 8 |
| TPSA(Topological polar surface area) | 104.06 |
| logS(The logarithm of aqueous solubility value) | -3.079 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 0.556 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | -0.253 |
| Quantitative Estimate of Drug-likeness | 0.484 |
| Synthetic accessibility score | 6.69 |
| Natural Product-likeness score | 3.652 |
| Lipinski Rule | Accepted |
| GSK Rule | Accepted |
| Golden Triangle | Accepted |
| Caco-2 Permeability | -5.955 |
| MDCK Permeability | 2.54E-05 |
| Pgp-substrate | 0.917 |
| HIA(human intestinal absorption) | 0.052 |
| F20%(20% Oral Bioavailability) | 0.657 |
| F30%(30% Oral Bioavailability) | 0.262 |
| PPB(Plasma protein binding) | 28.71% |
| VD(Volume Distribution) | 0.395 |
| BBB Penetration(Blood brain barrier penetration) | 0.219 |
| B3 Penetration(Blood brain barrier penetration) | Non-Permeable |
| Fu(The fraction unbound in plasms) | 59.71% |
| CYP1A2 inhibitor | 0.002 |
| CYP1A2 substrate | 0.933 |
| CYP2C19 inhibitor | 0.009 |
| CYP2C19 substrate | 0.237 |
| CYP2C9 inhibitor | 0.004 |
| CYP2C9 substrate | 0.062 |
| CYP2D6 inhibitor | 0.004 |
| CYP2D6 substrate | 0.098 |
| CYP3A4 inhibitor | 0.258 |
| CYP3A4 substrate | 0.039 |
| CL(The clearance of a drug) | 2.075 |
| T1/2 | 0.397 |
| NonBiodegradable Rule | 0 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.423 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.947 |
| IGC50 | 2.152 |
| LC50FM | 3.496 |
| LC50DM | 6.475 |
| NR-AR(Androgen receptor) | 0.26 |
| NR-AR-LBD(Androgen receptor) | 0.928 |
| NR-Aromatase | 0.808 |
| NR-ER(Estrogen receptor) | 0.612 |
| NR-ER-LBD(Estrogen receptor) | 0.016 |
| Skin Sensitization Rule | 1 |
| Skin Sensitization | 0.211 |
| Acute Toxicity Rule | 3 |
| Rat Oral Acute Toxicity | 0.435 |
| hERG Blockers | 0.135 |
| H-HT(The human hepatotoxicity) | 0.887 |
| DILI(Drug-induced liver injury) | 0.048 |
| Eye Corrosion | 0.004 |
| Eye Irritation | 0.015 |
| Respiratory Toxicity | 0.98 |
| AMES Toxicity | 0.029 |
| Carcinogencity | 0.345 |
| SR-ARE(Antioxidant Response Element) | 0.714 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.888 |
| SR-p53 | 0.974 |