| Ingredient Name | (2R)-2-[(3S,10S,13R,14R,16R,17R)-3,16-dihydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid |
| Pubchem CID | 216251 |
| Iupac name | (2R)-2-[(3S,10S,13R,14R,16R,17R)-3,16-dihydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid |
| Molecular Formula | C31H48O4 |
| Molecular Weight | 484.7 |
| Isomeric smiles | CC(C)C(=C)CC[C@H]([C@H]1[C@@H](C[C@@]2([C@@]1(CC=C3C2=CCC4[C@@]3(CC[C@@H](C4(C)C)O)C)C)C)O)C(=O)O |
| InChI | InChI=1S/C31H48O4/c1-18(2)19(3)9-10-20(27(34)35)26-23(32)17-31(8)22-11-12-24-28(4,5)25(33)14-15-29(24,6)21(22)13-16-30(26,31)7/h11,13,18,20,23-26,32-33H,3,9-10,12,14-17H2,1-2,4-8H3,(H,34,35)/t20-,23-,24?,25+,26+,29-,30-,31+/m1/s1 |
| InChIKey | LADJWZMBZBVBSB-DWSVKRSBSA-N |
| External Database Links |
| nHA(Number of hydrogen bond acceptors) | 4 |
| nHD(Number of hydrogen bond donors) | 3 |
| nRot(Number of rotatable bonds) | 6 |
| nRing(Number of rings) | 4 |
| MaxRing(Number of atoms in the biggest ring) | 17 |
| nHet(Number of heteroatoms) | 4 |
| nRig(Number of rigid bonds) | 22 |
| Flexibility | 0.273 |
| Stereo Centers(Number of stereocenters) | 8 |
| TPSA(Topological polar surface area) | 77.76 |
| logS(The logarithm of aqueous solubility value) | -4.799 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 5.422 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 4.355 |
| Quantitative Estimate of Drug-likeness | 0.374 |
| Synthetic accessibility score | 5.14 |
| Natural Product-likeness score | 3.527 |
| Lipinski Rule | Accepted |
| GSK Rule | Rejected |
| Golden Triangle | Accepted |
| Caco-2 Permeability | -5.057 |
| MDCK Permeability | 2.29E-05 |
| Pgp-substrate | 0.003 |
| HIA(human intestinal absorption) | 0.004 |
| F20%(20% Oral Bioavailability) | 0.044 |
| F30%(30% Oral Bioavailability) | 0.025 |
| PPB(Plasma protein binding) | 93.87% |
| VD(Volume Distribution) | 0.748 |
| BBB Penetration(Blood brain barrier penetration) | 0.084 |
| B3 Penetration(Blood brain barrier penetration) | Permeable |
| Fu(The fraction unbound in plasms) | 4.11% |
| CYP1A2 inhibitor | 0.007 |
| CYP1A2 substrate | 0.153 |
| CYP2C19 inhibitor | 0.011 |
| CYP2C19 substrate | 0.912 |
| CYP2C9 inhibitor | 0.105 |
| CYP2C9 substrate | 0.916 |
| CYP2D6 inhibitor | 0.002 |
| CYP2D6 substrate | 0.28 |
| CYP3A4 inhibitor | 0.078 |
| CYP3A4 substrate | 0.287 |
| CL(The clearance of a drug) | 2.69 |
| T1/2 | 0.203 |
| NonBiodegradable Rule | 0 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.798 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.944 |
| IGC50 | 3.801 |
| LC50FM | 4.825 |
| LC50DM | 4.939 |
| NR-AR(Androgen receptor) | 0.489 |
| NR-AR-LBD(Androgen receptor) | 0.096 |
| NR-Aromatase | 0.787 |
| NR-ER(Estrogen receptor) | 0.122 |
| NR-ER-LBD(Estrogen receptor) | 0.017 |
| Skin Sensitization Rule | 0 |
| Skin Sensitization | 0.871 |
| Acute Toxicity Rule | 1 |
| Rat Oral Acute Toxicity | 0.317 |
| hERG Blockers | 0.057 |
| H-HT(The human hepatotoxicity) | 0.558 |
| DILI(Drug-induced liver injury) | 0.01 |
| Eye Corrosion | 0.006 |
| Eye Irritation | 0.016 |
| Respiratory Toxicity | 0.972 |
| AMES Toxicity | 0.01 |
| Carcinogencity | 0.552 |
| SR-ARE(Antioxidant Response Element) | 0.15 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.059 |
| SR-p53 | 0.689 |