| Ingredient Name | Butanoic acid, 3-(acetyloxy)-3-methyl-, 1-(1,4-dihydro-5,8-dihydroxy-1,4-dioxo-2-naphthalenyl)-4-methyl-3-pentenyl ester, (S)- |
| Pubchem CID | 155245 |
| Iupac name | [(1S)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 3-acetyloxy-3-methylbutanoate |
| Molecular Formula | C23H26O8 |
| Molecular Weight | 430.4 |
| Isomeric smiles | CC(=CC[C@@H](C1=CC(=O)C2=C(C=CC(=C2C1=O)O)O)OC(=O)CC(C)(C)OC(=O)C)C |
| InChI | InChI=1S/C23H26O8/c1-12(2)6-9-18(30-19(28)11-23(4,5)31-13(3)24)14-10-17(27)20-15(25)7-8-16(26)21(20)22(14)29/h6-8,10,18,25-26H,9,11H2,1-5H3/t18-/m0/s1 |
| InChIKey | BQSAGDWOHVQNFB-SFHVURJKSA-N |
| External Database Links |
| nHA(Number of hydrogen bond acceptors) | 8 |
| nHD(Number of hydrogen bond donors) | 2 |
| nRot(Number of rotatable bonds) | 9 |
| nRing(Number of rings) | 2 |
| MaxRing(Number of atoms in the biggest ring) | 10 |
| nHet(Number of heteroatoms) | 8 |
| nRig(Number of rigid bonds) | 16 |
| Flexibility | 0.562 |
| Stereo Centers(Number of stereocenters) | 1 |
| TPSA(Topological polar surface area) | 127.2 |
| logS(The logarithm of aqueous solubility value) | -4.691 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 4.451 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 2.897 |
| Quantitative Estimate of Drug-likeness | 0.383 |
| Synthetic accessibility score | 3.701 |
| Natural Product-likeness score | 2.114 |
| Lipinski Rule | Accepted |
| GSK Rule | Rejected |
| Golden Triangle | Accepted |
| Caco-2 Permeability | -4.689 |
| MDCK Permeability | 3.40E-05 |
| Pgp-substrate | 0.003 |
| HIA(human intestinal absorption) | 0.285 |
| F20%(20% Oral Bioavailability) | 0.184 |
| F30%(30% Oral Bioavailability) | 0.986 |
| PPB(Plasma protein binding) | 92.06% |
| VD(Volume Distribution) | 0.823 |
| BBB Penetration(Blood brain barrier penetration) | 0.026 |
| B3 Penetration(Blood brain barrier penetration) | Non-Permeable |
| Fu(The fraction unbound in plasms) | 7.90% |
| CYP1A2 inhibitor | 0.924 |
| CYP1A2 substrate | 0.082 |
| CYP2C19 inhibitor | 0.82 |
| CYP2C19 substrate | 0.063 |
| CYP2C9 inhibitor | 0.903 |
| CYP2C9 substrate | 0.902 |
| CYP2D6 inhibitor | 0.87 |
| CYP2D6 substrate | 0.132 |
| CYP3A4 inhibitor | 0.681 |
| CYP3A4 substrate | 0.169 |
| CL(The clearance of a drug) | 9.155 |
| T1/2 | 0.203 |
| NonBiodegradable Rule | 1 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.98 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.914 |
| IGC50 | 5.582 |
| LC50FM | 6.788 |
| LC50DM | 6.979 |
| NR-AR(Androgen receptor) | 0.008 |
| NR-AR-LBD(Androgen receptor) | 0.613 |
| NR-Aromatase | 0.554 |
| NR-ER(Estrogen receptor) | 0.544 |
| NR-ER-LBD(Estrogen receptor) | 0.925 |
| Skin Sensitization Rule | 9 |
| Skin Sensitization | 0.773 |
| Acute Toxicity Rule | 3 |
| Rat Oral Acute Toxicity | 0.91 |
| hERG Blockers | 0.008 |
| H-HT(The human hepatotoxicity) | 0.692 |
| DILI(Drug-induced liver injury) | 0.875 |
| Eye Corrosion | 0.014 |
| Eye Irritation | 0.103 |
| Respiratory Toxicity | 0.948 |
| AMES Toxicity | 0.937 |
| Carcinogencity | 0.814 |
| SR-ARE(Antioxidant Response Element) | 0.938 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.498 |
| SR-p53 | 0.979 |