| Ingredient Name | D-Serine, N-((5-((6-deoxy-3-O-beta-D-xylopyranosyl-beta-D-galactopyranosyl)oxy)-5,6,8,13-tetrahydro-1,6,9,14-tetrahydroxy-11-methoxy-3-methyl-8,13-dioxobenzo(a)naphthacen-2-yl)carbonyl)-, (5S-trans)- |
| Pubchem CID | 122695 |
| Iupac name | 2-[[(5S)-5-[3,5-dihydroxy-6-methyl-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-1,6,9,14-tetrahydroxy-11-methoxy-3-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carbonyl]amino]-3-hydroxypropanoic acid |
| Molecular Formula | C39H41NO20 |
| Molecular Weight | 843.7 |
| Isomeric smiles | CC1C(C(C(C(O1)O[C@@H]2C(C3=CC4=C(C(=C3C5=C2C=C(C(=C5O)C(=O)NC(CO)C(=O)O)C)O)C(=O)C6=C(C4=O)C(=CC(=C6)OC)O)O)O)OC7C(C(C(CO7)O)O)O)O |
| InChI | InChI=1S/C39H41NO20/c1-10-4-16-23(30(49)20(10)36(53)40-17(8-41)37(54)55)22-14(7-15-24(31(22)50)27(46)13-5-12(56-3)6-18(42)21(13)26(15)45)28(47)34(16)59-39-33(52)35(25(44)11(2)58-39)60-38-32(51)29(48)19(43)9-57-38/h4-7,11,17,19,25,28-29,32-35,38-39,41-44,47-52H,8-9H2,1-3H3,(H,40,53)(H,54,55)/t11?,17?,19?,25?,28?,29?,32?,33?,34-,35?,38?,39?/m0/s1 |
| InChIKey | AXPBRQZJFXIYTD-PWEAUJHISA-N |
| External Database Links | TCMSuite: 23150 |
| nHA(Number of hydrogen bond acceptors) | 21 |
| nHD(Number of hydrogen bond donors) | 12 |
| nRot(Number of rotatable bonds) | 10 |
| nRing(Number of rings) | 7 |
| MaxRing(Number of atoms in the biggest ring) | 22 |
| nHet(Number of heteroatoms) | 21 |
| nRig(Number of rigid bonds) | 42 |
| Flexibility | 0.238 |
| Stereo Centers(Number of stereocenters) | 12 |
| TPSA(Topological polar surface area) | 348.99 |
| logS(The logarithm of aqueous solubility value) | -4.225 |
| logP(The logarithm of the n-octanol/water distribution coefficient) | 0.458 |
| logD7.4(The logarithm of the n-octanol/water distribution coefficients at pH=7.4) | 1.175 |
| Quantitative Estimate of Drug-likeness | 0.088 |
| Synthetic accessibility score | 5.574 |
| Natural Product-likeness score | 1.617 |
| Lipinski Rule | Rejected |
| GSK Rule | Rejected |
| Golden Triangle | Rejected |
| Caco-2 Permeability | -6.556 |
| MDCK Permeability | 7.76E-06 |
| Pgp-substrate | 0.997 |
| HIA(human intestinal absorption) | 0.997 |
| F20%(20% Oral Bioavailability) | 0.949 |
| F30%(30% Oral Bioavailability) | 1 |
| PPB(Plasma protein binding) | 73.67% |
| VD(Volume Distribution) | 0.673 |
| BBB Penetration(Blood brain barrier penetration) | 0.049 |
| B3 Penetration(Blood brain barrier penetration) | Non-Permeable |
| Fu(The fraction unbound in plasms) | 11.92% |
| CYP1A2 inhibitor | 0.002 |
| CYP1A2 substrate | 0.011 |
| CYP2C19 inhibitor | 0.012 |
| CYP2C19 substrate | 0.038 |
| CYP2C9 inhibitor | 0.003 |
| CYP2C9 substrate | 0.045 |
| CYP2D6 inhibitor | 0 |
| CYP2D6 substrate | 0.078 |
| CYP3A4 inhibitor | 0.027 |
| CYP3A4 substrate | 0.006 |
| CL(The clearance of a drug) | 1 |
| T1/2 | 0.066 |
| NonBiodegradable Rule | 2 |
| Pfizer Rule | Accepted |
| SR-MMP | 0.763 |
| FDAMDD(FDA Maximum (Recommended) Daily Dose) | 0.011 |
| IGC50 | 4.474 |
| LC50FM | 4.076 |
| LC50DM | 6.728 |
| NR-AR(Androgen receptor) | 0.484 |
| NR-AR-LBD(Androgen receptor) | 0.263 |
| NR-Aromatase | 0.373 |
| NR-ER(Estrogen receptor) | 0.243 |
| NR-ER-LBD(Estrogen receptor) | 0.067 |
| Skin Sensitization Rule | 7 |
| Skin Sensitization | 0.004 |
| Acute Toxicity Rule | 2 |
| Rat Oral Acute Toxicity | 0.012 |
| hERG Blockers | 0.06 |
| H-HT(The human hepatotoxicity) | 0.205 |
| DILI(Drug-induced liver injury) | 0.993 |
| Eye Corrosion | 0.003 |
| Eye Irritation | 0.004 |
| Respiratory Toxicity | 0.009 |
| AMES Toxicity | 0.79 |
| Carcinogencity | 0.029 |
| SR-ARE(Antioxidant Response Element) | 0.135 |
| SR-ATAD5(ATPase family AAA domain-containing protein 5) | 0.711 |
| SR-p53 | 0.849 |